PDB ligand accession: PPG
DrugBank: DB03287
PubChem: n/a
ChEMBL: n/a
InChI Key: OBCQKAZQAHYUOZ-CALQLVRRSA-N
SMILES: Cc1c(c(c(cn1)COP(=O)(O)O)CN=C(C=COCCN)C(=O)O)O
ClassyFire chemical classification:
- Kingdom: Organic compounds
- Superclass: Organoheterocyclic compounds
- Class: Pyridines and derivatives
- Subclass: Pyridoxamines
- Class: Pyridines and derivatives
- Superclass: Organoheterocyclic compounds
# | DrugDomain Data | UniProt Accession | Protein name | Drug Action | Affinity data |
---|---|---|---|---|---|
1 | P06721_PPG | P06721 | Cystathionine beta-lyase MetC | n/a | |
2 | P37821_PPG | P37821 | 1-aminocyclopropane-1-carboxylate synthase (ACC | n/a | |
3 | Q56257_PPG | Q56257 | cysteine-S-conjugate beta-lyase (EC | n/a | |
4 | Q9STR4_PPG | Q9STR4 | 1-aminocyclopropane-1-carboxylate synthase 7 | n/a |