PDB ligand accession: PT1
DrugBank: DB04196
PubChem: 95054;5281044;135398749;
ChEMBL:
InChI Key: JOAQINSXLLMRCV-UHFFFAOYSA-N
SMILES: c1cc(ccc1C(=O)O)NCc2cnc3c(n2)c(nc(n3)N)O
ClassyFire chemical classification:
- Kingdom: Organic compounds
- Superclass: Organoheterocyclic compounds
- Class: Pteridines and derivatives
- Subclass: Pterins and derivatives
- Class: Pteridines and derivatives
- Superclass: Organoheterocyclic compounds
| # | DrugDomain Data | UniProt Accession | Protein name | Drug Action | Affinity data |
|---|---|---|---|---|---|
| 1 | Q7CKJ1_PT1 | Q7CKJ1 | Dihydropteroate synthase (DHPS) | n/a | |
| 2 | Q25704_PT1 | Q25704 | 7,8-dihydro-6-hydroxymethylpterin pyrophosphokinase-dihydropteroate synthase | n/a | |
| 3 | Q81VW8_PT1 | Q81VW8 | Dihydropteroate synthase (DHPS) | n/a | |
| 4 | A0A160WS51_PT1 | A0A160WS51 | deleted | n/a | |
| 5 | P0AC14_PT1 | P0AC14 | Dihydropteroate synthase (DHPS) | n/a | |
| 6 | Q83BY6_PT1 | Q83BY6 | dihydropteroate synthase (EC | n/a | |
| 7 | Q9AVR2_PT1 | Q9AVR2 | Ribosome-inactivating protein [Cleaved | n/a | |
| 8 | P02879_PT1 | P02879 | Ricin [Cleaved into: | n/a |