PDB ligand accession: PTR
DrugBank: DB01962
PubChem:
ChEMBL:
InChI Key: DCWXELXMIBXGTH-QMMMGPOBSA-N
SMILES: c1cc(ccc1CC(C(=O)O)N)OP(=O)(O)O
ClassyFire chemical classification:
- Kingdom: Organic compounds
- Superclass: Organic acids and derivatives
- Class: Carboxylic acids and derivatives
- Subclass: Amino acids, peptides, and analogues
- Class: Carboxylic acids and derivatives
- Superclass: Organic acids and derivatives
# | DrugDomain Data | UniProt Accession | Protein name | Drug Action | Affinity data |
---|---|---|---|---|---|
1 | P54829_PTR | P54829 | Tyrosine-protein phosphatase non-receptor | n/a | |
2 | P18031_PTR | P18031 | Tyrosine-protein phosphatase non-receptor | n/a | |
3 | P40479_PTR | P40479 | Dual-specificity protein phosphatase | n/a | |
4 | A0A2S1ZT94_PTR | A0A2S1ZT94 | non-specific protein-tyrosine kinase | n/a | |
5 | P12931_PTR | P12931 | Proto-oncogene tyrosine-protein kinase | inhibitor | |
6 | P30086_PTR | P30086 | Phosphatidylethanolamine-binding protein 1 | n/a | |
7 | P10721_PTR | P10721 | Mast/stem cell growth | inhibitor | |
8 | P08631_PTR | P08631 | Tyrosine-protein kinase HCK | n/a | |
9 | D3HJY4_PTR | D3HJY4 | SH2 domain-containing protein | n/a |