PDB ligand accession: PUB
DrugBank: n/a
PubChem:
ChEMBL: n/a
InChI Key: KDCCOOGTVSRCHX-YYVBKQGDSA-N
SMILES: CCC1=C(C(=O)NC1Cc2c(c(c([nH]2)C=C3C(=C(C(=N3)CC4C(=C(C(=O)N4)CC)C)C)CCC(=O)O)CCC(=O)O)C)C
ClassyFire chemical classification:
- Kingdom: Organic compounds
- Superclass: Organoheterocyclic compounds
- Class: Tetrapyrroles and derivatives
- Subclass: Bilirubins
- Class: Tetrapyrroles and derivatives
- Superclass: Organoheterocyclic compounds
# | DrugDomain Data | UniProt Accession | Protein name | Drug Action | Affinity data |
---|---|---|---|---|---|
1 | Q7NLD6_PUB | Q7NLD6 | Phycoerythrin beta subunit | n/a | |
2 | Q7SIF9_PUB | Q7SIF9 | R-phycoerythrin beta chain | n/a | |
3 | O36004_PUB | O36004 | R-phycoerythrin beta chain | n/a | |
4 | F2ZAL7_PUB | F2ZAL7 | Phycoerythrin beta subunit | n/a | |
5 | Q01922_PUB | Q01922 | R-phycoerythrin beta chain | n/a | |
6 | P11393_PUB | P11393 | B-phycoerythrin beta chain | n/a | |
7 | E2IH77_PUB | E2IH77 | Phycoerythrin alpha subunit | n/a |