PDB ligand accession: PXQ
DrugBank: n/a
PubChem: n/a
ChEMBL: n/a
InChI Key: RIXXCMVADHNPLY-UKJJQICTSA-N
SMILES: CCC1C(C(=O)N=C1Cc2c(c(c([nH]2)Cc3c(c(c([nH]3)C=C4C(=C(C(=O)N4)CC)C)C)CCC(=O)O)CCC(=O)O)C)C
ClassyFire chemical classification:
- Kingdom: Organic compounds
- Superclass: Organoheterocyclic compounds
- Class: Tetrapyrroles and derivatives
- Subclass: Bilirubins
- Class: Tetrapyrroles and derivatives
- Superclass: Organoheterocyclic compounds
| # | DrugDomain Data | UniProt Accession | Protein name | Drug Action | Affinity data |
|---|---|---|---|---|---|
| 1 | A0A4Y5PW22_PXQ | A0A4Y5PW22 | Allophycocyanin alpha | n/a | |
| 2 | P50033_PXQ | P50033 | C-phycocyanin beta subunit | n/a | |
| 3 | P50032_PXQ | P50032 | C-phycocyanin alpha subunit | n/a | |
| 4 | A0A4Y5PW23_PXQ | A0A4Y5PW23 | Allophycocyanin beta | n/a |