PDB ligand accession: QKM
DrugBank: DB11633
PubChem:
ChEMBL:
InChI Key: DDFOUSQFMYRUQK-RCDICMHDSA-N
SMILES: CC(c1nc(cs1)c2ccc(cc2)C#N)C(Cn3cncn3)(c4cc(ccc4F)F)O
ClassyFire chemical classification:
- Kingdom: Organic compounds
- Superclass: Benzenoids
- Class: Benzene and substituted derivatives
- Subclass: Phenylpropanes
- Class: Benzene and substituted derivatives
- Superclass: Benzenoids
# | DrugDomain Data | UniProt Accession | Protein name | Drug Action | Affinity data |
---|---|---|---|---|---|
1 | L8GJB3_QKM | L8GJB3 | Obtusifoliol 14alphademethylase, putative | n/a | |
2 | P22460_QKM | P22460 | Potassium voltage-gated channel | inhibitor | |
3 | Q13936_QKM | Q13936 | Voltage-dependent L-type calcium | inhibitor | |
4 | Q14654_QKM | Q14654 | ATP-sensitive inward rectifier | inhibitor | |
5 | Q92806_QKM | Q92806 | G protein-activated inward | inhibitor | |
6 | Q9UK17_QKM | Q9UK17 | A-type voltage-gated potassium | inhibitor | |
7 | P48051_QKM | P48051 | G protein-activated inward | inhibitor | |
8 | P51787_QKM | P51787 | Potassium voltage-gated channel | inhibitor | |
9 | Q12809_QKM | Q12809 | Voltage-gated inwardly rectifying | inhibitor | |
10 | Q14524_QKM | Q14524 | Sodium channel protein | inhibitor |