PDB ligand accession: QRP
DrugBank: n/a
PubChem:
ChEMBL:
InChI Key: RYFZBPVMVYTEKZ-KBPBESRZSA-N
SMILES: c1ccc2c(c1)c(c[nH]2)CC3C(=O)N4CCCC4C(=O)N3
ClassyFire chemical classification:
- Kingdom: Organic compounds
- Superclass: Organic acids and derivatives
- Class: Carboxylic acids and derivatives
- Subclass: Amino acids, peptides, and analogues
- Class: Carboxylic acids and derivatives
- Superclass: Organic acids and derivatives
# | DrugDomain Data | UniProt Accession | Protein name | Drug Action | Affinity data |
---|---|---|---|---|---|
1 | A0A8I3B027_QRP | A0A8I3B027 | Cytochrome P450-F5053 (cytochrome | n/a | |
2 | E0Y3X1_QRP | E0Y3X1 | Deoxybrevianamide E synthase | n/a | |
3 | A0A3G1Q973_QRP | A0A3G1Q973 | NascB | n/a | |
4 | A0A8I3B029_QRP | A0A8I3B029 | cytochrome P450 NasF5053 | n/a | |
5 | Q4G2I1_QRP | Q4G2I1 | Tryprostatin B synthase | n/a | |
6 | A0A8I3B028_QRP | A0A8I3B028 | cytochrome P450 NasF5053 | n/a | |
7 | A0A9X9ZA09_QRP | A0A9X9ZA09 | AspB | n/a | |
8 | A0A8I3B043_QRP | A0A8I3B043 | NzeB | n/a |