PDB ligand accession: QUS
DrugBank: DB02999
PubChem: 40539;6971145;
ChEMBL:
InChI Key: ASNFTDCKZKHJSW-REOHCLBHSA-N
SMILES: C(C(C(=O)O)N)N1C(=O)NC(=O)O1
ClassyFire chemical classification:
- Kingdom: Organic compounds
- Superclass: Organic acids and derivatives
- Class: Carboxylic acids and derivatives
- Subclass: Amino acids, peptides, and analogues
- Class: Carboxylic acids and derivatives
- Superclass: Organic acids and derivatives
# | DrugDomain Data | UniProt Accession | Protein name | Drug Action | Affinity data |
---|---|---|---|---|---|
1 | Q13002_QUS | Q13002 | Glutamate receptor ionotropic, | n/a | |
2 | P19491_QUS | P19491 | Glutamate receptor 2 | n/a | |
3 | Q13255_QUS | Q13255 | Metabotropic glutamate receptor | agonist | Ki(nM) = 10.0 EC50(nM) = 200.0 |
4 | P41594_QUS | P41594 | Metabotropic glutamate receptor | inhibitor | Ki(nM) = 29.0 EC50(nM) = 150.0 |
5 | P42262_QUS | P42262 | Glutamate receptor 2 | n/a | |
6 | Q9Y3Q0_QUS | Q9Y3Q0 | N-acetylated-alpha-linked acidic dipeptidase | n/a | |
7 | Q04609_QUS | Q04609 | Glutamate carboxypeptidase 2 | inhibitor | IC50(nM) = 9500.0 |
8 | P19492_QUS | P19492 | Glutamate receptor 3 | n/a | Ki(nM) = 10000.0 |
9 | P42260_QUS | P42260 | Glutamate receptor ionotropic, | n/a | Ki(nM) = 134.0 |