PDB ligand accession: RIS
DrugBank: DB00884
PubChem: 5245;44400168;
ChEMBL:
InChI Key: IIDJRNMFWXDHID-UHFFFAOYSA-N
SMILES: c1cc(cnc1)CC(O)(P(=O)(O)O)P(=O)(O)O
ClassyFire chemical classification:
- Kingdom: Organic compounds
- Superclass: Organic acids and derivatives
- Class: Organic phosphonic acids and derivatives
- Subclass: Bisphosphonates
- Class: Organic phosphonic acids and derivatives
- Superclass: Organic acids and derivatives
# | DrugDomain Data | UniProt Accession | Protein name | Drug Action | Affinity data |
---|---|---|---|---|---|
1 | A0A6M9XZI2_RIS | A0A6M9XZI2 | deleted | n/a | |
2 | Q8WS26_RIS | Q8WS26 | Farnesyl diphosphate synthase | n/a | |
3 | P22939_RIS | P22939 | Farnesyl diphosphate synthase | n/a | |
4 | Q9K499_RIS | Q9K499 | Epi-isozizaene synthase (EIZS) | n/a | |
5 | Q86C09_RIS | Q86C09 | Farnesyl pyrophosphate synthase | n/a | |
6 | Q5CR09_RIS | Q5CR09 | Putative farnesyl pyrophosphate | n/a | |
7 | P14324_RIS | P14324 | Farnesyl pyrophosphate synthase | inhibitor | Ki(nM) = 0.36 IC50(nM) = 0.36 |