PDB ligand accession: RIT
DrugBank: DB00503
PubChem:
ChEMBL:
InChI Key: NCDNCNXCDXHOMX-XGKFQTDJSA-N
SMILES: CC(C)c1nc(cs1)CN(C)C(=O)NC(C(C)C)C(=O)NC(Cc2ccccc2)CC(C(Cc3ccccc3)NC(=O)OCc4cncs4)O
ClassyFire chemical classification:
- Kingdom: Organic compounds
- Superclass: Organic acids and derivatives
- Class: Carboxylic acids and derivatives
- Subclass: Amino acids, peptides, and analogues
- Class: Carboxylic acids and derivatives
- Superclass: Organic acids and derivatives
# | DrugDomain Data | UniProt Accession | Protein name | Drug Action | Affinity data |
---|---|---|---|---|---|
1 | O75469_RIT | O75469 | Nuclear receptor subfamily | activator | EC50(nM) = 4000.0 |
2 | P03367_RIT | P03367 | Gag-Pol polyprotein (Pr160Gag-Pol) | n/a | |
3 | P08684_RIT | P08684 | Cytochrome P450 3A4 | n/a | IC50(nM) = 130.0 |
4 | P03369_RIT | P03369 | Gag-Pol polyprotein (Pr160Gag-Pol) | n/a | |
5 | P00791_RIT | P00791 | Pepsin A (EC | n/a | |
6 | P11838_RIT | P11838 | Endothiapepsin (EC 3.4.23.22) | n/a | |
7 | P28871_RIT | P28871 | Secreted aspartic protease | n/a | |
8 | Q9J006_RIT | Q9J006 | Protease | n/a | |
9 | P20815_RIT | P20815 | Cytochrome P450 3A5 | n/a | |
10 | B8YPM3_RIT | B8YPM3 | candidapepsin (EC 3.4.23.24) | n/a | |
11 | Q7SMT3_RIT | Q7SMT3 | Pol polyprotein | n/a | |
12 | Q7SSI0_RIT | Q7SSI0 | Protease | n/a | |
13 | Q000H7_RIT | Q000H7 | Pol protein | n/a | |
14 | P12499_RIT | P12499 | Gag-Pol polyprotein (Pr160Gag-Pol) | n/a | |
15 | Q8I6V3_RIT | Q8I6V3 | Plasmepsin II (EC | n/a |