Ligand name: 3,5,3'TRIIODOTHYRONINE
PDB ligand accession: T3
DrugBank: DB00279
PubChem: 5920;7048703;
ChEMBL: CHEMBL1544
InChI Key: AUYYCJSJGJYCDS-LBPRGKRZSA-N
SMILES: c1cc(c(cc1Oc2c(cc(cc2I)CC(C(=O)O)N)I)I)O

ClassyFire chemical classification:

List of proteins that are targets for T3

# DrugDomain Data UniProt Accession Protein name Drug Action Affinity data
1 P10827_T3 P10827 Thyroid hormone receptor agonist Ki(nM) = 0.22
IC50(nM) = 0.24
Kd(nM) = 0.058
EC50(nM) = 0.41
2 P12004_T3 P12004 Proliferating cell nuclear antagonist IC50(nM) = 3600.0
3 Q9PTT3_T3 Q9PTT3 Transthyretin n/a
4 P04625_T3 P04625 Thyroid hormone receptor n/a
5 Q6FH41_T3 Q6FH41 Thyroid hormone receptor n/a
6 O54983_T3 O54983 Ketimine reductase mu-crystallin n/a
7 P10275_T3 P10275 Androgen receptor (Dihydrotestosterone n/a IC50(nM) = 50000.0
8 P10828_T3 P10828 Thyroid hormone receptor agonist Ki(nM) = 0.08
IC50(nM) = 0.257
Kd(nM) = 0.081
EC50(nM) = 1.1