PDB ligand accession: T44
DrugBank: DB00451
PubChem: 5819;25201348;
ChEMBL:
InChI Key: XUIIKFGFIJCVMT-LBPRGKRZSA-N
SMILES: c1c(cc(c(c1I)Oc2cc(c(c(c2)I)O)I)I)CC(C(=O)O)N
ClassyFire chemical classification:
- Kingdom: Organic compounds
- Superclass: Organic acids and derivatives
- Class: Carboxylic acids and derivatives
- Subclass: Amino acids, peptides, and analogues
- Class: Carboxylic acids and derivatives
- Superclass: Organic acids and derivatives
# | DrugDomain Data | UniProt Accession | Protein name | Drug Action | Affinity data |
---|---|---|---|---|---|
1 | P06756_T44 | P06756 | Integrin alpha-V (Vitronectin | binder | |
2 | P05106_T44 | P05106 | Integrin beta-3 (Platelet | binder | |
3 | Q9PTT3_T44 | Q9PTT3 | Transthyretin | n/a | |
4 | P02766_T44 | P02766 | Transthyretin (ATTR) (Prealbumin) | n/a | IC50(nM) = 2188.0 |
5 | P10827_T44 | P10827 | Thyroid hormone receptor | agonist | EC50(nM) = 19.0 |
6 | P02767_T44 | P02767 | Transthyretin (Prealbumin) (TBPA) | n/a | |
7 | P02768_T44 | P02768 | Albumin | n/a | |
8 | Q06S87_T44 | Q06S87 | 5-hydroxyisourate hydrolase (HIU | n/a | |
9 | P10828_T44 | P10828 | Thyroid hormone receptor | agonist | EC50(nM) = 240.0 |
10 | P05543_T44 | P05543 | Thyroxine-binding globulin (Serpin | n/a |