PDB ligand accession: THH
DrugBank: DB11256
PubChem: 444412;5287865;135398561;
ChEMBL:
InChI Key: ZNOVTXRBGFNYRX-STQMWFEESA-N
SMILES: CN1c2c(nc(nc2O)N)NCC1CNc3ccc(cc3)C(=O)NC(CCC(=O)O)C(=O)O
ClassyFire chemical classification:
- Kingdom: Organic compounds
- Superclass: Organoheterocyclic compounds
- Class: Pteridines and derivatives
- Subclass: Pterins and derivatives
- Class: Pteridines and derivatives
- Superclass: Organoheterocyclic compounds
# | DrugDomain Data | UniProt Accession | Protein name | Drug Action | Affinity data |
---|---|---|---|---|---|
1 | A0A133CK16_THH | A0A133CK16 | Serine hydroxymethyltransferase (SHMT) | n/a | |
2 | P48728_THH | P48728 | Aminomethyltransferase, mitochondrial (EC | n/a | |
3 | Q24SP6_THH | Q24SP6 | [methyl-Co(III) glycine betaine-specific | n/a | |
4 | P71554_THH | P71554 | Phosphoribosylglycinamide formyltransferase (EC | n/a | |
5 | P41440_THH | P41440 | Reduced folate transporter | n/a | |
6 | B8FUR2_THH | B8FUR2 | Tetrahydromethanopterin S-methyltransferase (EC | n/a | |
7 | Q8ABD0_THH | Q8ABD0 | Methionine synthase (EC | n/a | |
8 | P0ABE7_THH | P0ABE7 | Soluble cytochrome b562 | n/a |