PDB ligand accession: TLM
DrugBank: DB04302
PubChem:
ChEMBL:
InChI Key: SYQNUQSGEWNWKV-XUIVZRPNSA-N
SMILES: CC1=C(C(SC1=O)(C)C=C(C)C=C)O
ClassyFire chemical classification:
- Kingdom: Organic compounds
- Superclass: Organoheterocyclic compounds
- Class: Dihydrothiophenes
- Subclass: None
- Class: Dihydrothiophenes
- Superclass: Organoheterocyclic compounds
| # | DrugDomain Data | UniProt Accession | Protein name | Drug Action | Affinity data |
|---|---|---|---|---|---|
| 1 | P0A953_TLM | P0A953 | 3-oxoacyl-[acyl-carrier-protein] synthase 1 | n/a | |
| 2 | I6Y8T4_TLM | I6Y8T4 | deleted | n/a | |
| 3 | P63454_TLM | P63454 | 3-oxoacyl-[acyl-carrier-protein] synthase 1 | n/a |