PDB ligand accession: TP7
DrugBank: n/a
PubChem:
ChEMBL: n/a
InChI Key: JBJSVEVEEGOEBZ-SCZZXKLOSA-N
SMILES: CC(C(C(=O)O)NC(=O)CCCCCCS)OP(=O)(O)O
ClassyFire chemical classification:
- Kingdom: Organic compounds
- Superclass: Organic acids and derivatives
- Class: Carboxylic acids and derivatives
- Subclass: Amino acids, peptides, and analogues
- Class: Carboxylic acids and derivatives
- Superclass: Organic acids and derivatives
# | DrugDomain Data | UniProt Accession | Protein name | Drug Action | Affinity data |
---|---|---|---|---|---|
1 | A0A2D0TC97_TP7 | A0A2D0TC97 | Heterodisulfide reductase, subunit | n/a | |
2 | A0A247D6X4_TP7 | A0A247D6X4 | Methyl-coenzyme M reductase | n/a | |
3 | A0A1C7D1E4_TP7 | A0A1C7D1E4 | Methyl-coenzyme M reductase | n/a | |
4 | D9PXZ6_TP7 | D9PXZ6 | Methyl-coenzyme M reductase | n/a | |
5 | P58815_TP7 | P58815 | Methyl-coenzyme M reductase | n/a | |
6 | P07955_TP7 | P07955 | Methyl-coenzyme M reductase | n/a | |
7 | Q49605_TP7 | Q49605 | Methyl-coenzyme M reductase | n/a | |
8 | A0A8I3AZW5_TP7 | A0A8I3AZW5 | Methyl-coenzyme M reductase | n/a | |
9 | A0A1C7D1E2_TP7 | A0A1C7D1E2 | Methyl-coenzyme M reductase | n/a | |
10 | A0A8I3AZW4_TP7 | A0A8I3AZW4 | Methyl-coenzyme M reductase | n/a | |
11 | P11558_TP7 | P11558 | Methyl-coenzyme M reductase | n/a | |
12 | A0A247D6X3_TP7 | A0A247D6X3 | Methyl-coenzyme M reductase | n/a | |
13 | A0A2D0TCB4_TP7 | A0A2D0TCB4 | Heterodisulfide reductase, subunit | n/a | |
14 | P11560_TP7 | P11560 | Methyl-coenzyme M reductase | n/a | |
15 | H7CHY2_TP7 | H7CHY2 | coenzyme-B sulfoethylthiotransferase (EC | n/a | |
16 | H1KXL5_TP7 | H1KXL5 | Methyl-coenzyme M reductase | n/a | |
17 | A0A7R9N4Z1_TP7 | A0A7R9N4Z1 | coenzyme-B sulfoethylthiotransferase (EC | n/a | |
18 | Q8THH1_TP7 | Q8THH1 | Methyl-coenzyme M reductase | n/a | |
19 | Q8THG7_TP7 | Q8THG7 | Methyl-coenzyme M reductase | n/a | |
20 | H1KXL9_TP7 | H1KXL9 | Methyl-coenzyme M reductase | n/a | |
21 | D1JBK2_TP7 | D1JBK2 | coenzyme-B sulfoethylthiotransferase (EC | n/a | |
22 | A0A7R9R780_TP7 | A0A7R9R780 | coenzyme-B sulfoethylthiotransferase (EC | n/a | |
23 | H7CHY1_TP7 | H7CHY1 | coenzyme-B sulfoethylthiotransferase (EC | n/a | |
24 | D1JBK4_TP7 | D1JBK4 | Methyl-coenzyme M reductase | n/a | |
25 | P07962_TP7 | P07962 | Methyl-coenzyme M reductase | n/a | |
26 | Q49601_TP7 | Q49601 | Methyl-coenzyme M reductase | n/a |