PDB ligand accession: TPF
DrugBank: DB00196
PubChem:
ChEMBL:
InChI Key: RFHAOTPXVQNOHP-UHFFFAOYSA-N
SMILES: c1cc(c(cc1F)F)C(Cn2cncn2)(Cn3cncn3)O
ClassyFire chemical classification:
- Kingdom: Organic compounds
- Superclass: Benzenoids
- Class: Benzene and substituted derivatives
- Subclass: Halobenzenes
- Class: Benzene and substituted derivatives
- Superclass: Benzenoids
# | DrugDomain Data | UniProt Accession | Protein name | Drug Action | Affinity data |
---|---|---|---|---|---|
1 | P14779_TPF | P14779 | Bifunctional cytochrome P450/NADPH--P450 | n/a | |
2 | Q7Z1V1_TPF | Q7Z1V1 | Sterol 14-alpha demethylase | n/a | IC50(nM) = 880.0 Kd(nM) = 230.0 |
3 | A0A2H4A2U9_TPF | A0A2H4A2U9 | CYP51, sterol 14alpha-demethylase | n/a | |
4 | P0A514_TPF | P0A514 | Mycocyclosin synthase (EC | n/a | |
5 | Q385E8_TPF | Q385E8 | Lanosterol 14-alpha-demethylase (EC | n/a | |
6 | Q5I4E1_TPF | Q5I4E1 | Sterol 14-alpha demethylase | n/a | |
7 | A2TEF2_TPF | A2TEF2 | Putative lanosterol 14-alpha-demethylase | n/a | |
8 | P77901_TPF | P77901 | Sterol 14alpha-demethylase (EC | n/a | |
9 | P08684_TPF | P08684 | Cytochrome P450 3A4 | n/a | IC50(nM) = 8000.0 |
10 | A6ZSR0_TPF | A6ZSR0 | sterol 14alpha-demethylase (EC | n/a |