PDB ligand accession: U
DrugBank: DB03685
PubChem:
ChEMBL:
InChI Key: DJJCXFVJDGTHFX-XVFCMESISA-N
SMILES: C1=CN(C(=O)NC1=O)C2C(C(C(O2)COP(=O)(O)O)O)O
ClassyFire chemical classification:
- Kingdom: Organic compounds
- Superclass: Nucleosides, nucleotides, and analogues
- Class: Pyrimidine nucleotides
- Subclass: Pyrimidine ribonucleotides
- Class: Pyrimidine nucleotides
- Superclass: Nucleosides, nucleotides, and analogues
# | DrugDomain Data | UniProt Accession | Protein name | Drug Action | Affinity data |
---|---|---|---|---|---|
1 | Q9HUF6_U | Q9HUF6 | UDP-glucose:(Heptosyl) LPS alpha | n/a | |
2 | Q96AZ6_U | Q96AZ6 | Interferon-stimulated gene 20 | n/a | |
3 | Q9BT17_U | Q9BT17 | Mitochondrial ribosome-associated GTPase | n/a | |
4 | O26745_U | O26745 | Putative snRNP Sm-like | n/a | |
5 | P09001_U | P09001 | Large ribosomal subunit | n/a | |
6 | Q9BYD1_U | Q9BYD1 | Large ribosomal subunit | n/a | |
7 | K5B7Z4_U | K5B7Z4 | Glucosyl-3-phosphoglycerate synthase (EC | n/a | |
8 | Q5SKU2_U | Q5SKU2 | Translation initiation factor | n/a | |
9 | Q9H2W6_U | Q9H2W6 | Large ribosomal subunit | n/a | |
10 | Q9NWZ5_U | Q9NWZ5 | Uridine-cytidine kinase-like 1 | n/a | |
11 | Q5SLQ0_U | Q5SLQ0 | Small ribosomal subunit | n/a | |
12 | P0A1R0_U | P0A1R0 | RNA-binding protein Hfq | n/a | |
13 | P15291_U | P15291 | Beta-1,4-galactosyltransferase 1 (Beta-1,4-GalTase | n/a | |
14 | Q6P1L8_U | Q6P1L8 | Large ribosomal subunit | n/a | |
15 | Q96EL3_U | Q96EL3 | Large ribosomal subunit | n/a | |
16 | Q7TG18_U | Q7TG18 | Genome polyprotein | n/a | |
17 | Q7Z4J2_U | Q7Z4J2 | Putative glycosyltransferase 6 | n/a | |
18 | P21513_U | P21513 | Ribonuclease E (RNase | n/a | |
19 | Q06151_U | Q06151 | m7GpppX diphosphatase (EC | n/a | |
20 | Q9NVS2_U | Q9NVS2 | Large ribosomal subunit | n/a | |
21 | P49406_U | P49406 | Large ribosomal subunit | n/a | |
22 | P17291_U | P17291 | Small ribosomal subunit | n/a | |
23 | P21589_U | P21589 | 5'-nucleotidase (5'-NT) (EC | n/a | |
24 | Q9P0J6_U | Q9P0J6 | Large ribosomal subunit | n/a | |
25 | Q5SHR1_U | Q5SHR1 | Translation initiation factor | n/a | |
26 | P11172_U | P11172 | Uridine 5'-monophosphate synthase | n/a |