PDB ligand accession: U2G
DrugBank: DB04514
PubChem: 89950;5289519;135403833;
ChEMBL: n/a
InChI Key: DFYLLEBFVZTKHD-VMIOUTBZSA-N
SMILES: c1nc2c(n1C3C(C(C(O3)COP(=O)(O)OC4C(C(OC4N5C=CC(=O)NC5=O)CO)O)O)O)N=C(NC2=O)N
ClassyFire chemical classification:
- Kingdom: Organic compounds
- Superclass: Nucleosides, nucleotides, and analogues
- Class: Purine nucleotides
- Subclass: Purine ribonucleotides
- Class: Purine nucleotides
- Superclass: Nucleosides, nucleotides, and analogues
# | DrugDomain Data | UniProt Accession | Drug Action | Affinity data |
---|---|---|---|---|
1 | P00669_U2G | P00669 | n/a | |
2 | P07998_U2G | P07998 | n/a | |
3 | P61823_U2G | P61823 | n/a |