Ligand name: 3-{(1R)-1-[(3-methyl-4-{[6-(trifluoromethyl)pyridin-3-yl]methyl}-1H-pyrrole-2-carbonyl)amino]ethyl}-1H-pyrazole-5-carboxamide
PDB ligand accession: XE7
DrugBank: n/a
PubChem: 155908680
ChEMBL: n/a
InChI Key: YOVYZOJIMZERTC-SNVBAGLBSA-N
SMILES: Cc1c(c[nH]c1C(=O)NC(C)c2cc([nH]n2)C(=O)N)Cc3ccc(nc3)C(F)(F)F

ClassyFire chemical classification:

List of proteins that are targets for XE7

# DrugDomain Data UniProt Accession Protein name Drug Action Affinity data
1 Q08210_XE7 Q08210 Dihydroorotate dehydrogenase (quinone), n/a