PDB ligand accession: XFN
DrugBank: n/a
PubChem:
ChEMBL:
InChI Key: WZQDEYWNUPXXDO-UHFFFAOYSA-N
SMILES: Cc1cc(nc(c1)N)CCc2cc(cc(c2)N)CCc3cc(cc(n3)N)C
ClassyFire chemical classification:
- Kingdom: Organic compounds
- Superclass: Benzenoids
- Class: Benzene and substituted derivatives
- Subclass: Aniline and substituted anilines
- Class: Benzene and substituted derivatives
- Superclass: Benzenoids
| # | DrugDomain Data | UniProt Accession | Protein name | Drug Action | Affinity data |
|---|---|---|---|---|---|
| 1 | O34453_XFN | O34453 | Nitric oxide synthase | n/a | |
| 2 | P29473_XFN | P29473 | Nitric oxide synthase | n/a | |
| 3 | P29476_XFN | P29476 | Nitric oxide synthase | n/a |