PDB ligand accession: XMP
DrugBank: DB02309
PubChem: n/a
ChEMBL: n/a
InChI Key: DCTLYFZHFGENCW-UUOKFMHZSA-O
SMILES: c1[nH+]c2c(n1C3C(C(C(O3)COP(=O)(O)O)O)O)NC(=O)NC2=O
ClassyFire chemical classification:
- Kingdom: Organic compounds
- Superclass: Nucleosides, nucleotides, and analogues
- Class: Purine nucleotides
- Subclass: Purine ribonucleotides
- Class: Purine nucleotides
- Superclass: Nucleosides, nucleotides, and analogues
# | DrugDomain Data | UniProt Accession | Protein name | Drug Action | Affinity data |
---|---|---|---|---|---|
1 | Q926Y9_XMP | Q926Y9 | Inosine-5'-monophosphate dehydrogenase (IMP | n/a | |
2 | Q07010_XMP | Q07010 | Hypoxanthine-guanine phosphoribosyltransferase (HGPRT) | n/a | |
3 | P00492_XMP | P00492 | Hypoxanthine-guanine phosphoribosyltransferase (HGPRT) | n/a | |
4 | P11172_XMP | P11172 | Uridine 5'-monophosphate synthase | n/a | |
5 | Q5SI28_XMP | Q5SI28 | GMP synthase [glutamine-hydrolyzing] | n/a | |
6 | Q9SKY5_XMP | Q9SKY5 | At2g32150/F22D22.10 (Haloacid dehalogenase-like | n/a | |
7 | P31335_XMP | P31335 | Bifunctional purine biosynthesis | n/a | |
8 | P50097_XMP | P50097 | Inosine-5'-monophosphate dehydrogenase (IMP | n/a | |
9 | Q58531_XMP | Q58531 | GMP synthase [glutamine-hydrolyzing] | n/a | |
10 | O58045_XMP | O58045 | Inosine-5'-monophosphate dehydrogenase (IMP | n/a | |
11 | Q81W29_XMP | Q81W29 | Inosine-5'-monophosphate dehydrogenase (IMP | n/a | |
12 | O58462_XMP | O58462 | Orotidine 5'-phosphate decarboxylase | n/a | |
13 | Q9KTW3_XMP | Q9KTW3 | Inosine-5'-monophosphate dehydrogenase (IMP | n/a | |
14 | Q26997_XMP | Q26997 | Hypoxanthine-guanine-xanthine phosphoribosyltransferase (HGPRT) | n/a | |
15 | P9WKI7_XMP | P9WKI7 | Inosine-5'-monophosphate dehydrogenase (IMP | n/a | |
16 | Q8IJR9_XMP | Q8IJR9 | GMP synthase [glutamine-hydrolyzing] | n/a | |
17 | Q38CA1_XMP | Q38CA1 | Hypoxanthine-guanine phosphoribosyltransferase, putative | n/a | |
18 | P49915_XMP | P49915 | GMP synthase [glutamine-hydrolyzing] | n/a | |
19 | Q8T6J6_XMP | Q8T6J6 | Orotidine 5'-phosphate decarboxylase | n/a | |
20 | P31939_XMP | P31939 | Bifunctional purine biosynthesis | n/a | |
21 | O26232_XMP | O26232 | Orotidine 5'-phosphate decarboxylase | n/a |