PDB ligand accession: XNV
DrugBank: n/a
PubChem:
ChEMBL: n/a
InChI Key: WVFVHUYBPRBKRA-UEXGIBASSA-N
SMILES: CCOC(=O)CCC(CC1CCNC1=O)NC(=O)C(CC#C)N2C=CC=C(C2=O)NC(=O)c3cc(on3)C
ClassyFire chemical classification:
- Kingdom: Organic compounds
- Superclass: Organic acids and derivatives
- Class: Carboxylic acids and derivatives
- Subclass: Amino acids, peptides, and analogues
- Class: Carboxylic acids and derivatives
- Superclass: Organic acids and derivatives
| # | DrugDomain Data | UniProt Accession | Protein name | Drug Action | Affinity data |
|---|---|---|---|---|---|
| 1 | P0C6U8_XNV | P0C6U8 | Replicase polyprotein 1a | n/a | |
| 2 | Q5DSM6_XNV | Q5DSM6 | Genome polyprotein [Cleaved | n/a | |
| 3 | P0DTD1_XNV | P0DTD1 | Replicase polyprotein 1ab | n/a |