PDB ligand accession: XRA
DrugBank: DB00457
PubChem:
ChEMBL:
InChI Key: IENZQIKPVFGBNW-UHFFFAOYSA-N
SMILES: COc1cc2c(cc1OC)nc(nc2N)N3CCN(CC3)C(=O)c4ccco4
ClassyFire chemical classification:
- Kingdom: Organic compounds
- Superclass: Organoheterocyclic compounds
- Class: Diazinanes
- Subclass: Piperazines
- Class: Diazinanes
- Superclass: Organoheterocyclic compounds
| # | DrugDomain Data | UniProt Accession | Protein name | Drug Action | Affinity data | |
|---|---|---|---|---|---|---|
| 1 | Q12809_XRA | Q12809 | Voltage-gated inwardly rectifying | inhibitor | IC50(nM) = 1584.89 | |
| 2 | P25100_XRA | P25100 | Alpha-1D adrenergic receptor | n/a | antagonist | Ki(nM) = 0.06 |
| 3 | P18089_XRA | P18089 | Alpha-2B adrenergic receptor | binder | Ki(nM) = 13.0 | |
| 4 | P35348_XRA | P35348 | Alpha-1A adrenergic receptor | antagonist | n/a | Ki(nM) = 0.03 IC50(nM) = 1.2 |
| 5 | P35368_XRA | P35368 | Alpha-1B adrenergic receptor | antagonist | n/a | Ki(nM) = 0.06 |
| 6 | P08913_XRA | P08913 | Alpha-2A adrenergic receptor | binder | Ki(nM) = 210.0 | |
| 7 | P16083_XRA | P16083 | Ribosyldihydronicotinamide dehydrogenase [quinone] | n/a | IC50(nM) = 7.8 |