PDB ligand accession: Y01
DrugBank: n/a
PubChem:
ChEMBL: n/a
InChI Key: WLNARFZDISHUGS-MIXBDBMTSA-N
SMILES: CC(C)CCCC(C)C1CCC2C1(CCC3C2CC=C4C3(CCC(C4)OC(=O)CCC(=O)O)C)C
ClassyFire chemical classification:
- Kingdom: Organic compounds
- Superclass: Lipids and lipid-like molecules
- Class: Steroids and steroid derivatives
- Subclass: Steroid esters
- Class: Steroids and steroid derivatives
- Superclass: Lipids and lipid-like molecules
| # | DrugDomain Data | UniProt Accession | Protein name | Drug Action | Affinity data |
|---|---|---|---|---|---|
| 1 | O14649_Y01 | O14649 | Potassium channel subfamily | n/a | |
| 2 | P02730_Y01 | P02730 | Band 3 anion | n/a | |
| 3 | Q59EX4_Y01 | Q59EX4 | Phospholipid-transporting ATPase (EC | n/a | |
| 4 | P45844_Y01 | P45844 | ATP-binding cassette sub-family | n/a | |
| 5 | P20309_Y01 | P20309 | Muscarinic acetylcholine receptor | n/a | |
| 6 | Q9LD83_Y01 | Q9LD83 | Guard cell S-type | n/a | |
| 7 | A0A338P6L0_Y01 | A0A338P6L0 | G protein-activated inward | n/a | |
| 8 | O45730_Y01 | O45730 | ABC transporter domain-containing | n/a | |
| 9 | Q9UL62_Y01 | Q9UL62 | Short transient receptor | n/a | |
| 10 | Q8N697_Y01 | Q8N697 | Solute carrier family | n/a | |
| 11 | Q9UKL4_Y01 | Q9UKL4 | Gap junction delta-2 | n/a | |
| 12 | Q7NDN8_Y01 | Q7NDN8 | Proton-gated ion channel | n/a | |
| 13 | Q923J1_Y01 | Q923J1 | Transient receptor potential | n/a | |
| 14 | Q86Y34_Y01 | Q86Y34 | Adhesion G protein-coupled | n/a | |
| 15 | A0A0B4KEX2_Y01 | A0A0B4KEX2 | Transporter | n/a | |
| 16 | P62873_Y01 | P62873 | Guanine nucleotide-binding protein | n/a | |
| 17 | Q9QUQ5_Y01 | Q9QUQ5 | Short transient receptor | n/a | |
| 18 | Q9NP58_Y01 | Q9NP58 | ATP-binding cassette sub-family | n/a | |
| 19 | Q12200_Y01 | Q12200 | NPC intracellular sterol | n/a | |
| 20 | P31645_Y01 | P31645 | Sodium-dependent serotonin transporter | n/a | |
| 21 | P05026_Y01 | P05026 | Sodium/potassium-transporting ATPase subunit | n/a | |
| 22 | P78348_Y01 | P78348 | Acid-sensing ion channel | n/a | |
| 23 | P32297_Y01 | P32297 | Neuronal acetylcholine receptor | n/a | |
| 24 | P30988_Y01 | P30988 | Calcitonin receptor (CT-R) | n/a | |
| 25 | Q84TH5_Y01 | Q84TH5 | ABC transporter G | n/a | |
| 26 | Q13507_Y01 | Q13507 | Short transient receptor | n/a | |
| 27 | P17787_Y01 | P17787 | Neuronal acetylcholine receptor | n/a | |
| 28 | P47870_Y01 | P47870 | Gamma-aminobutyric acid receptor | n/a | |
| 29 | P05023_Y01 | P05023 | Sodium/potassium-transporting ATPase subunit | n/a | |
| 30 | P47900_Y01 | P47900 | P2Y purinoceptor 1 | n/a | |
| 31 | P17302_Y01 | P17302 | Gap junction alpha-1 | n/a | |
| 32 | G3IEF0_Y01 | G3IEF0 | UbiA prenyltransferase domain-containing | n/a | |
| 33 | Q01650_Y01 | Q01650 | Large neutral amino | n/a | |
| 34 | P54710_Y01 | P54710 | Sodium/potassium-transporting ATPase subunit | n/a | |
| 35 | F6RG56_Y01 | F6RG56 | Mucolipin-3 (Transient receptor | n/a | |
| 36 | Q13336_Y01 | Q13336 | Urea transporter 1 | n/a | |
| 37 | Q9H1D0_Y01 | Q9H1D0 | Transient receptor potential | n/a | |
| 38 | P15389_Y01 | P15389 | Sodium channel protein | n/a | |
| 39 | Q9JJ59_Y01 | Q9JJ59 | ABC-type oligopeptide transporter | n/a | |
| 40 | Q9HBA0_Y01 | Q9HBA0 | Transient receptor potential | n/a | |
| 41 | P43681_Y01 | P43681 | Neuronal acetylcholine receptor | n/a | |
| 42 | Q15878_Y01 | Q15878 | Voltage-dependent R-type calcium | n/a | |
| 43 | Q8TD43_Y01 | Q8TD43 | Transient receptor potential | n/a | |
| 44 | P13866_Y01 | P13866 | Sodium/glucose cotransporter 1 | n/a | |
| 45 | P55017_Y01 | P55017 | Solute carrier family | n/a | |
| 46 | O43520_Y01 | O43520 | Phospholipid-transporting ATPase IC | n/a | |
| 47 | U3N7D8_Y01 | U3N7D8 | Short transient receptor | n/a | |
| 48 | Q9QX29_Y01 | Q9QX29 | Short transient receptor | n/a | |
| 49 | P20963_Y01 | P20963 | T-cell surface glycoprotein | n/a | |
| 50 | Q3KSP2_Y01 | Q3KSP2 | BILF1 (G protein-coupled | n/a | |
| 51 | P54826_Y01 | P54826 | Growth arrest-specific protein | n/a | |
| 52 | P21447_Y01 | P21447 | ATP-dependent translocase ABCB1 | n/a | |
| 53 | P43004_Y01 | P43004 | Excitatory amino acid | n/a | |
| 54 | P07700_Y01 | P07700 | Beta-1 adrenergic receptor | n/a | |
| 55 | Q5QD08_Y01 | Q5QD08 | Trace amine-associated receptor | n/a | |
| 56 | Q9NRK6_Y01 | Q9NRK6 | ATP-binding cassette sub-family | n/a | |
| 57 | A0A4X1TV69_Y01 | A0A4X1TV69 | Transporter | n/a | |
| 58 | Q7K4Y6_Y01 | Q7K4Y6 | Sodium-dependent dopamine transporter | n/a | |
| 59 | P32238_Y01 | P32238 | Cholecystokinin receptor type | n/a | |
| 60 | D9IEF7_Y01 | D9IEF7 | Endolysin (EC 3.2.1.17) | n/a | |
| 61 | Q63563_Y01 | Q63563 | ATP-binding cassette sub-family | n/a | |
| 62 | P41594_Y01 | P41594 | Metabotropic glutamate receptor | n/a | |
| 63 | P11229_Y01 | P11229 | Muscarinic acetylcholine receptor | n/a | |
| 64 | O43497_Y01 | O43497 | Voltage-dependent T-type calcium | n/a | |
| 65 | Q9NUT2_Y01 | Q9NUT2 | Mitochondrial potassium channel | n/a | |
| 66 | P14867_Y01 | P14867 | Gamma-aminobutyric acid receptor | n/a | |
| 67 | Q15722_Y01 | Q15722 | Leukotriene B4 receptor | n/a | |
| 68 | P30926_Y01 | P30926 | Neuronal acetylcholine receptor | n/a | |
| 69 | P55011_Y01 | P55011 | Solute carrier family | n/a | |
| 70 | E1B792_Y01 | E1B792 | Uncharacterized protein | n/a | |
| 71 | Q6Z2T3_Y01 | Q6Z2T3 | Aquaporin NIP2-1 (Low | n/a | |
| 72 | P18507_Y01 | P18507 | Gamma-aminobutyric acid receptor | n/a | |
| 73 | P43005_Y01 | P43005 | Excitatory amino acid | n/a | |
| 74 | P11169_Y01 | P11169 | Solute carrier family | n/a | |
| 75 | C0KD15_Y01 | C0KD15 | Glutamate receptor ionotropic, | n/a | |
| 76 | A0A6P3HVI0_Y01 | A0A6P3HVI0 | Sodium/hydrogen exchanger 9B2 | n/a | |
| 77 | Q9P0X4_Y01 | Q9P0X4 | Voltage-dependent T-type calcium | n/a |