PDB ligand accession: BPH
DrugBank: n/a
PubChem: n/a
ChEMBL: n/a
InChI Key: KWOZSBGNAHVCKG-SZQBJALDSA-N
SMILES: CCC1c2cc3c(c4c([nH]3)c(c5nc(cc6c(c(c([nH]6)cc(n2)C1C)C(=O)C)C)C(C5CCC(=O)OCC=C(C)CCCC(C)CCCC(C)CCCC(C)C)C)C(C4=O)C(=O)OC)C
Drug action: n/a
| PDB/AF Accession | PyMOL script | Experimental / Predicted | Interacting ECOD domains | ECOD X-group name | LigPlot |
|---|---|---|---|---|---|
| 7YML | Download | Experimental | e7ymlL1 e7ymlM1 e7ymlL1 e7ymlM1 e7ymlY1 | Bacterial photosystem II reaction centre L and M subunits-like Bacterial photosystem II reaction centre L and M subunits-like Bacterial photosystem II reaction centre L and M subunits-like Bacterial photosystem II reaction centre L and M subunits-like Bacterial light-harvesting complex subunits | LigPlot |