PDB ligand accession: ZDC
DrugBank: n/a
PubChem:
ChEMBL: n/a
InChI Key: YTZUDUWVQZSKNN-OASCRQMUSA-N
SMILES: CC1C(C(C(C(O1)CC(=O)O)O)O)O
Drug action: n/a
ClassyFire chemical classification:
- Kingdom: Organic compounds
- Superclass: Organic oxygen compounds
- Class: Organooxygen compounds
- Subclass: Carbohydrates and carbohydrate conjugates
- Class: Organooxygen compounds
- Superclass: Organic oxygen compounds
| PDB/AF Accession | PyMOL script | Experimental / Predicted | Interacting ECOD domains | ECOD X-group name | LigPlot |
|---|---|---|---|---|---|
| 6Y0X | Download | Experimental | e6y0xA1 e6y0xB1 e6y0xB1 e6y0xF1 e6y0xB1 e6y0xC1 e6y0xC1 e6y0xA1 e6y0xC1 e6y0xD1 e6y0xE1 e6y0xD1 e6y0xE1 e6y0xF1 e6y0xE1 e6y0xD1 e6y0xF1 | beta-propeller-like beta-propeller-like beta-propeller-like beta-propeller-like beta-propeller-like beta-propeller-like beta-propeller-like beta-propeller-like beta-propeller-like beta-propeller-like beta-propeller-like beta-propeller-like beta-propeller-like beta-propeller-like beta-propeller-like beta-propeller-like beta-propeller-like | LigPlot |