Ligand name: MENAQUINONE 8
PDB ligand accession: MQ8
DrugBank: n/a
PubChem: 5288843
ChEMBL: n/a
InChI Key: LXKDFTDVRVLXFY-ACMRXAIVSA-N
SMILES: CC1=C(C(=O)c2ccccc2C1=O)CC=C(C)CCC=C(C)CCC=C(C)CCC=C(C)CCC=C(C)CCC=C(C)CCC=C(C)CCC=C(C)C
Drug action: n/a

ClassyFire chemical classification:

• Kingdom: Organic compounds
  • Superclass: Lipids and lipid-like molecules
    • Class: Prenol lipids
      • Subclass: Quinone and hydroquinone lipids

List of PDB structures and/or AlphaFold models with target protein A0A143BHR2

PDB/AF Accession	PyMOL script	Experimental / Predicted	Interacting ECOD domains	ECOD X-group name	LigPlot
7O0V	Download	Experimental	e7o0vL1 e7o0vac1 e7o0vad1 e7o0vH11 e7o0vL1 e7o0vL1 e7o0vam1 e7o0van1 e7o0vao1 e7o0vap1	Bacterial photosystem II reaction centre L and M subunits-like Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Photosystem II reaction centre subunit H, transmembrane region Bacterial photosystem II reaction centre L and M subunits-like Bacterial photosystem II reaction centre L and M subunits-like Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits	LigPlot
7O0U	Download	Experimental	e7o0uL1 e7o0uac1 e7o0uad1 e7o0uH11 e7o0uL1 e7o0uL1 e7o0uam1 e7o0uan1 e7o0uao1 e7o0uap1	Bacterial photosystem II reaction centre L and M subunits-like Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Photosystem II reaction centre subunit H, transmembrane region Bacterial photosystem II reaction centre L and M subunits-like Bacterial photosystem II reaction centre L and M subunits-like Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits	LigPlot
7O0X	Download	Experimental	e7o0xL1 e7o0xac1 e7o0xad1 e7o0xL1 e7o0xL1 e7o0xam1 e7o0xan1 e7o0xao1 e7o0xap1	Bacterial photosystem II reaction centre L and M subunits-like Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial photosystem II reaction centre L and M subunits-like Bacterial photosystem II reaction centre L and M subunits-like Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits	LigPlot
7O0W	Download	Experimental	e7o0wL1 e7o0wac1 e7o0wad1 e7o0wH11 e7o0wL1 e7o0wL1 e7o0wam1 e7o0wan1 e7o0wao1 e7o0wap1	Bacterial photosystem II reaction centre L and M subunits-like Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Photosystem II reaction centre subunit H, transmembrane region Bacterial photosystem II reaction centre L and M subunits-like Bacterial photosystem II reaction centre L and M subunits-like Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits	LigPlot