PDB ligand accession: BCL
DrugBank: DB01853
PubChem: 11953947;16057436;
ChEMBL: n/a
InChI Key: DSJXIQQMORJERS-AGGZHOMASA-M
SMILES: CCC1C(C2=CC3=C(C(=C4[N-]3[Mg+2]56[N]2=C1C=C7[N-]5C8=C(C(C(=O)C8=C7C)C(=O)OC)C9=[N]6C(=C4)C(C9CCC(=O)OCC=C(C)CCCC(C)CCCC(C)CCCC(C)C)C)C)C(=O)C)C
Drug action: n/a
ClassyFire chemical classification:
- Kingdom: Organic compounds
- Superclass: Organoheterocyclic compounds
- Class: Tetrapyrroles and derivatives
- Subclass: Metallotetrapyrroles
- Class: Tetrapyrroles and derivatives
- Superclass: Organoheterocyclic compounds
PDB/AF Accession | PyMOL script | Experimental / Predicted | Interacting ECOD domains | ECOD X-group name | LigPlot |
---|---|---|---|---|---|
7O0V | Download | Experimental | e7o0vba1 e7o0vbp1 e7o0vaa1 e7o0vap1 e7o0vba1 e7o0vbb1 e7o0vaa1 e7o0vab1 e7o0vbb1 e7o0vbc1 e7o0vab1 e7o0vac1 e7o0vbc1 e7o0vbd1 e7o0vac1 e7o0vad1 e7o0vbd1 e7o0vbe1 e7o0vad1 e7o0vae1 e7o0vbe1 e7o0vbf1 e7o0vae1 e7o0vaf1 e7o0vbf1 e7o0vbg1 e7o0vaf1 e7o0vag1 e7o0vbg1 e7o0vbh1 e7o0vag1 e7o0vah1 e7o0vbh1 e7o0vbi1 e7o0vah1 e7o0vai1 e7o0vbi1 e7o0vbj1 e7o0vai1 e7o0vaj1 e7o0vbj1 e7o0vbk1 e7o0vaj1 e7o0vak1 e7o0vbk1 e7o0vbl1 e7o0vak1 e7o0val1 e7o0vbl1 e7o0vbm1 e7o0val1 e7o0vam1 e7o0vbm1 e7o0vbn1 e7o0vam1 e7o0van1 e7o0vbo1 e7o0vbn1 e7o0van1 e7o0vao1 e7o0vbo1 e7o0vbp1 e7o0vao1 e7o0vap1 e7o0vbi1 e7o0vai1 e7o0vaj1 e7o0vbo1 e7o0vao1 e7o0vap1 | Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits | LigPlot |
7O0U | Download | Experimental | e7o0uba1 e7o0ubp1 e7o0uaa1 e7o0uap1 e7o0uba1 e7o0ubb1 e7o0uaa1 e7o0uab1 e7o0ubb1 e7o0ubc1 e7o0uab1 e7o0uac1 e7o0uL1 e7o0ubc1 e7o0ubd1 e7o0uac1 e7o0uad1 e7o0ubd1 e7o0ube1 e7o0uad1 e7o0uae1 e7o0ube1 e7o0ubf1 e7o0uae1 e7o0uaf1 e7o0ubf1 e7o0ubg1 e7o0uaf1 e7o0uag1 e7o0ubg1 e7o0ubh1 e7o0uag1 e7o0uah1 e7o0ubh1 e7o0ubi1 e7o0uah1 e7o0uai1 e7o0ubi1 e7o0ubj1 e7o0uai1 e7o0uaj1 e7o0uak1 e7o0ubj1 e7o0ubk1 e7o0uaj1 e7o0uak1 e7o0ubk1 e7o0ubl1 e7o0ual1 e7o0ubl1 e7o0ubm1 e7o0ual1 e7o0uam1 e7o0ubm1 e7o0ubn1 e7o0uam1 e7o0uan1 e7o0ubn1 e7o0ubo1 e7o0uan1 e7o0uao1 e7o0ubo1 e7o0ubp1 e7o0uao1 e7o0uap1 e7o0ubc1 e7o0ubd1 e7o0uac1 e7o0uad1 e7o0ubd1 e7o0uad1 e7o0uae1 e7o0uak1 e7o0ubj1 e7o0uaj1 e7o0ubl1 e7o0ual1 e7o0uam1 | Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial photosystem II reaction centre L and M subunits-like Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits | LigPlot |
7O0X | Download | Experimental | e7o0xba1 e7o0xbp1 e7o0xaa1 e7o0xap1 e7o0xba1 e7o0xbb1 e7o0xaa1 e7o0xab1 e7o0xbb1 e7o0xbc1 e7o0xab1 e7o0xac1 e7o0xbc1 e7o0xbd1 e7o0xL1 e7o0xac1 e7o0xad1 e7o0xbd1 e7o0xbe1 e7o0xad1 e7o0xae1 e7o0xbe1 e7o0xbf1 e7o0xae1 e7o0xaf1 e7o0xbf1 e7o0xbg1 e7o0xaf1 e7o0xag1 e7o0xbg1 e7o0xbh1 e7o0xag1 e7o0xah1 e7o0xbh1 e7o0xbi1 e7o0xah1 e7o0xai1 e7o0xbi1 e7o0xbj1 e7o0xai1 e7o0xaj1 e7o0xbj1 e7o0xbk1 e7o0xaj1 e7o0xak1 e7o0xbk1 e7o0xbl1 e7o0xak1 e7o0xal1 e7o0xbl1 e7o0xbm1 e7o0xal1 e7o0xam1 e7o0xbm1 e7o0xbn1 e7o0xam1 e7o0xan1 e7o0xbn1 e7o0xbo1 e7o0xan1 e7o0xao1 e7o0xbo1 e7o0xbp1 e7o0xao1 e7o0xap1 e7o0xbc1 e7o0xac1 e7o0xad1 e7o0xbe1 e7o0xae1 e7o0xaf1 e7o0xbf1 e7o0xaf1 e7o0xag1 e7o0xbg1 e7o0xag1 e7o0xah1 | Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial photosystem II reaction centre L and M subunits-like Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits | LigPlot |
7O0W | Download | Experimental | e7o0wba1 e7o0wbp1 e7o0waa1 e7o0wap1 e7o0wba1 e7o0wbb1 e7o0waa1 e7o0wab1 e7o0wbb1 e7o0wbc1 e7o0wab1 e7o0wac1 e7o0wbc1 e7o0wbd1 e7o0wL1 e7o0wac1 e7o0wad1 e7o0wbd1 e7o0wbe1 e7o0wad1 e7o0wae1 e7o0wbe1 e7o0wbf1 e7o0wae1 e7o0waf1 e7o0wbf1 e7o0wbg1 e7o0waf1 e7o0wag1 e7o0wbg1 e7o0wbh1 e7o0wag1 e7o0wah1 e7o0wbh1 e7o0wbi1 e7o0wah1 e7o0wai1 e7o0wbi1 e7o0wbj1 e7o0wai1 e7o0waj1 e7o0wbj1 e7o0wbk1 e7o0waj1 e7o0wak1 e7o0wbk1 e7o0wbl1 e7o0wak1 e7o0wal1 e7o0wbl1 e7o0wbm1 e7o0wal1 e7o0wam1 e7o0wbm1 e7o0wbn1 e7o0wam1 e7o0wan1 e7o0wbn1 e7o0wbo1 e7o0wan1 e7o0wao1 e7o0wbo1 e7o0wbp1 e7o0wao1 e7o0wap1 e7o0wbb1 e7o0wab1 e7o0wac1 e7o0wbc1 e7o0wbd1 e7o0wac1 e7o0wad1 e7o0wbd1 e7o0wad1 e7o0wae1 e7o0wbf1 e7o0waf1 e7o0wag1 e7o0wbl1 e7o0wal1 e7o0wam1 e7o0wbn1 e7o0wan1 e7o0wao1 | Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial photosystem II reaction centre L and M subunits-like Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits | LigPlot |