PDB ligand accession: BCR
DrugBank: DB06755
PubChem:
ChEMBL:
InChI Key: OENHQHLEOONYIE-JLTXGRSLSA-N
SMILES: CC1=C(C(CCC1)(C)C)C=CC(=CC=CC(=CC=CC=C(C)C=CC=C(C)C=CC2=C(CCCC2(C)C)C)C)C
Drug action: n/a
ClassyFire chemical classification:
- Kingdom: Organic compounds
- Superclass: Lipids and lipid-like molecules
- Class: Prenol lipids
- Subclass: Tetraterpenoids
- Class: Prenol lipids
- Superclass: Lipids and lipid-like molecules
| PDB/AF Accession | PyMOL script | Experimental / Predicted | Interacting ECOD domains | ECOD X-group name | LigPlot |
|---|---|---|---|---|---|
| 6PNJ | Download | Experimental | e6pnjB2 e6pnjI1 e6pnjL1 e6pnjL1 e6pnjU1 e6pnjH1 e6pnjR1 e6pnjU1 e6pnjU1 e6pnjl1 e6pnja1 e6pnjb2 e6pnji1 e6pnjl1 e6pnjL1 e6pnjl1 | Bacterial photosystem II reaction centre L and M subunits-like Subunit VIII of photosystem I reaction centre, PsaI Photosystem I reaction center subunit XI, PsaL Photosystem I reaction center subunit XI, PsaL Photosystem I reaction center subunit XI, PsaL Bacterial photosystem II reaction centre L and M subunits-like Subunit VIII of photosystem I reaction centre, PsaI Photosystem I reaction center subunit XI, PsaL Photosystem I reaction center subunit XI, PsaL Photosystem I reaction center subunit XI, PsaL Bacterial photosystem II reaction centre L and M subunits-like Bacterial photosystem II reaction centre L and M subunits-like Subunit VIII of photosystem I reaction centre, PsaI Photosystem I reaction center subunit XI, PsaL Photosystem I reaction center subunit XI, PsaL Photosystem I reaction center subunit XI, PsaL | LigPlot |