Ligand name: 1,2-Dihydro-psi,psi-caroten-1-ol
PDB ligand accession: IRM
DrugBank: n/a
PubChem: 5365880
ChEMBL: n/a
InChI Key: CNYVJTJLUKKCGM-RGGGOQHISA-N
SMILES: CC(=CCCC(=CC=CC(=CC=CC(=CC=CC=C(C)C=CC=C(C)C=CC=C(C)CCCC(C)(C)O)C)C)C)C
Drug action: n/a

ClassyFire chemical classification:

• Kingdom: Organic compounds
  • Superclass: Lipids and lipid-like molecules
    • Class: Prenol lipids
      • Subclass: Tetraterpenoids

List of PDB structures and/or AlphaFold models with target protein A0A2R4GRA8

PDB/AF Accession	PyMOL script	Experimental / Predicted	Interacting ECOD domains	ECOD X-group name	LigPlot
7ZE8	Download	Experimental	e7ze8A1 e7ze8O1 e7ze8Q1 e7ze8P1 e7ze8R1 e7ze8A1 e7ze8C1 e7ze8Q1 e7ze8B1 e7ze8R1 e7ze8C1 e7ze8E1 e7ze8G1 e7ze8D1 e7ze8F1 e7ze8A1 e7ze8C1 e7ze8E1 e7ze8B1 e7ze8D1 e7ze8G1 e7ze8I1 e7ze8K1 e7ze8H1 e7ze8J1 e7ze8E1 e7ze8G1 e7ze8I1 e7ze8F1 e7ze8H1 e7ze8I1 e7ze8K1 e7ze8M1 e7ze8J1 e7ze8L1 e7ze8K1 e7ze8M1 e7ze8O1 e7ze8L1 e7ze8N1 e7ze8M1 e7ze8O1 e7ze8Q1 e7ze8N1 e7ze8P1	Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits	LigPlot