Ligand name: 1,2-Dihydro-psi,psi-caroten-1-ol
PDB ligand accession: IRM
DrugBank: n/a
PubChem: 5365880
ChEMBL: n/a
InChI Key: CNYVJTJLUKKCGM-RGGGOQHISA-N
SMILES: CC(=CCCC(=CC=CC(=CC=CC(=CC=CC=C(C)C=CC=C(C)C=CC=C(C)CCCC(C)(C)O)C)C)C)C
Drug action: n/a

ClassyFire chemical classification:

• Kingdom: Organic compounds
  • Superclass: Lipids and lipid-like molecules
    • Class: Prenol lipids
      • Subclass: Tetraterpenoids

List of PDB structures and/or AlphaFold models with target protein A0A2R4GUT4

PDB/AF Accession	PyMOL script	Experimental / Predicted	Interacting ECOD domains	ECOD X-group name	LigPlot
7ZCU	Download	Experimental	e7zcuA1 e7zcuC1 e7zcuE1 e7zcuD1 e7zcuA1 e7zcuC1 e7zcuQ1 e7zcuB1 e7zcuC1 e7zcuE1 e7zcuG1 e7zcuF1 e7zcuE1 e7zcuG1 e7zcuI1 e7zcuH1 e7zcuG1 e7zcuI1 e7zcuK1 e7zcuJ1 e7zcuI1 e7zcuK1 e7zcuM1 e7zcuL1 e7zcuK1 e7zcuM1 e7zcuO1 e7zcuN1 e7zcuM1 e7zcuO1 e7zcuQ1 e7zcuP1 e7zcuA1 e7zcuO1 e7zcuQ1 e7zcuR1	Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits	LigPlot