Ligand name: BACTERIOCHLOROPHYLL A
PDB ligand accession: BCL
DrugBank: DB01853
PubChem: 11953947;16057436;
ChEMBL: n/a
InChI Key: DSJXIQQMORJERS-AGGZHOMASA-M
SMILES: CCC1C(C2=CC3=C(C(=C4[N-]3[Mg+2]56[N]2=C1C=C7[N-]5C8=C(C(C(=O)C8=C7C)C(=O)OC)C9=[N]6C(=C4)C(C9CCC(=O)OCC=C(C)CCCC(C)CCCC(C)CCCC(C)C)C)C)C(=O)C)C
Drug action: n/a

ClassyFire chemical classification:

• Kingdom: Organic compounds
  • Superclass: Organoheterocyclic compounds
    • Class: Tetrapyrroles and derivatives
      • Subclass: Metallotetrapyrroles

List of PDB structures and/or AlphaFold models with target protein A0A2R4GZC1

PDB/AF Accession	PyMOL script	Experimental / Predicted	Interacting ECOD domains	ECOD X-group name	LigPlot
7ZDI	Download	Experimental	e7zdiA1 e7zdiB1 e7zdiC1 e7zdiD1 e7zdiR1 e7zdiA1 e7zdiC1 e7zdiD1 e7zdiC1 e7zdiE1 e7zdiD1 e7zdiF1 e7zdiE1 e7zdiG1 e7zdiF1 e7zdiH1 e7zdiG1 e7zdiI1 e7zdiH1 e7zdiJ1 e7zdiG1 e7zdiI1 e7zdiJ1 e7zdiI1 e7zdiK1 e7zdiJ1 e7zdiL1 e7zdiI1 e7zdiK1 e7zdiL1 e7zdiK1 e7zdiM1 e7zdiL1 e7zdiN1 e7zdiK1 e7zdiM1 e7zdiN1 e7zdiM1 e7zdiO1 e7zdiN1 e7zdiP1 e7zdiO1 e7zdiQ1 e7zdiP1 e7zdiR1 e7zdiO1 e7zdiQ1 e7zdiR1 e7zdiA1 e7zdiB1 e7zdiQ1 e7zdiR1	Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits	LigPlot
7ZE8	Download	Experimental	e7ze8A1 e7ze8C1 e7ze8B1 e7ze8D1 e7ze8C1 e7ze8E1 e7ze8D1 e7ze8F1 e7ze8E1 e7ze8G1 e7ze8F1 e7ze8H1 e7ze8G1 e7ze8I1 e7ze8H1 e7ze8J1 e7ze8I1 e7ze8K1 e7ze8J1 e7ze8L1 e7ze8K1 e7ze8M1 e7ze8L1 e7ze8N1 e7ze8K1 e7ze8M1 e7ze8N1 e7ze8M1 e7ze8O1 e7ze8N1 e7ze8P1 e7ze8O1 e7ze8Q1 e7ze8P1 e7ze8R1 e7ze8O1 e7ze8Q1 e7ze8R1 e7ze8A1 e7ze8Q1 e7ze8B1 e7ze8R1 e7ze8F1	Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits	LigPlot