Ligand name: (6~{E},8~{E},10~{E},12~{E},14~{E},16~{E},18~{E},20~{E},22~{E},24~{E},26~{E},28~{E})-2,31-dimethoxy-2,6,10,14,19,23,27,31-octamethyl-dotriaconta-6,8,10,12,14,16,18,20,22,24,26,28-dodecaen-5-one
PDB ligand accession: I7D
DrugBank: n/a
PubChem: 87442067
ChEMBL: n/a
InChI Key: KSAQIRSWZGLSET-BOIKDPEESA-N
SMILES: CC(=CC=CC(=CC=CC(=CC=CC=C(C)C=CC=C(C)C=CC=C(C)C(=O)CCC(C)(C)OC)C)C)C=CCC(C)(C)OC
Drug action: n/a

ClassyFire chemical classification:

• Kingdom: Organic compounds
  • Superclass: Lipids and lipid-like molecules
    • Class: Prenol lipids
      • Subclass: Tetraterpenoids

List of PDB structures and/or AlphaFold models with target protein A0A2S6NEL9

PDB/AF Accession	PyMOL script	Experimental / Predicted	Interacting ECOD domains	ECOD X-group name	LigPlot
7XXF	Download	Experimental	e7xxfA1 e7xxf71 e7xxf91 e7xxf01 e7xxfA1 e7xxfD1 e7xxf91 e7xxfB1 e7xxfA1 e7xxfD1 e7xxfF1 e7xxfE1 e7xxfD1 e7xxfF1 e7xxfI1 e7xxfG1 e7xxfF1 e7xxfI1 e7xxfK1 e7xxfJ1 e7xxfI1 e7xxfK1 e7xxfO1 e7xxfN1 e7xxfK1 e7xxfO1 e7xxfQ1 e7xxfP1 e7xxfO1 e7xxfQ1 e7xxfS1 e7xxfR1 e7xxfQ1 e7xxfS1 e7xxfU1 e7xxfT1 e7xxfS1 e7xxfU1 e7xxfW1 e7xxfV1 e7xxfU1 e7xxfW1 e7xxfY1 e7xxfX1 e7xxfW1 e7xxfY1 e7xxf11 e7xxfZ1 e7xxfY1 e7xxf11 e7xxf31 e7xxf21 e7xxf11 e7xxf31 e7xxf51 e7xxf41 e7xxf31 e7xxf51 e7xxf71 e7xxf61 e7xxf51 e7xxf71 e7xxf91 e7xxf61 e7xxf81	Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits	LigPlot