PDB ligand accession: SPO
DrugBank: n/a
PubChem:
ChEMBL: n/a
InChI Key: FJOCMTHZSURUFA-KXCOHNEYSA-N
SMILES: CC(=CCCC(=CCCC(=CC=CC(=CC=CC=C(C)C=CC=C(C)C=CC=C(C)C=CCC(C)(C)OC)C)C)C)C
Drug action: n/a
ClassyFire chemical classification:
- Kingdom: Organic compounds
- Superclass: Lipids and lipid-like molecules
- Class: Prenol lipids
- Subclass: Tetraterpenoids
- Class: Prenol lipids
- Superclass: Lipids and lipid-like molecules
| PDB/AF Accession | PyMOL script | Experimental / Predicted | Interacting ECOD domains | ECOD X-group name | LigPlot |
|---|---|---|---|---|---|
| 7DDQ | Download | Experimental | e7ddqo1 e7ddqN1 e7ddqk1 e7ddqn1 e7ddqt1 e7ddqu1 e7ddqs1 e7ddqT1 e7ddqo1 e7ddqr1 e7ddqs1 e7ddqR1 e7ddqe1 e7ddqb1 e7ddqd1 e7ddqD1 e7ddqB1 e7ddqk1 e7ddqn1 e7ddqj1 e7ddqK1 e7ddqe1 e7ddqf1 e7ddqd1 e7ddqE1 e7ddqX1 e7ddqa1 e7ddqb1 e7ddqA1 e7ddqt1 e7ddqr1 e7ddqs1 e7ddqS1 e7ddqM1 e7ddqk1 e7ddqi1 e7ddqj1 e7ddqJ1 e7ddqi1 e7ddqj1 e7ddqg1 e7ddqI1 e7ddqM1 e7ddqj1 e7ddqf1 e7ddqi1 e7ddqg1 e7ddqG1 e7ddqH1 e7ddqe1 e7ddqf1 e7ddqg1 e7ddqF1 e7ddqa1 e7ddqb1 e7ddqd1 e7ddqA1 e7ddqB1 | Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Intrinsic membrane protein pufX Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial photosystem II reaction centre L and M subunits-like Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial photosystem II reaction centre L and M subunits-like Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Photosystem II reaction centre subunit H, transmembrane region Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits | LigPlot |