PDB ligand accession: PEE
DrugBank: DB04327
PubChem: 9546757;44251425;
ChEMBL: n/a
InChI Key: MWRBNPKJOOWZPW-NYVOMTAGSA-N
SMILES: CCCCCCCCC=CCCCCCCCC(=O)OCC(COP(=O)(O)OCCN)OC(=O)CCCCCCCC=CCCCCCCCC
Drug action: n/a
ClassyFire chemical classification:
- Kingdom: Organic compounds
- Superclass: Lipids and lipid-like molecules
- Class: Glycerophospholipids
- Subclass: Glycerophosphoethanolamines
- Class: Glycerophospholipids
- Superclass: Lipids and lipid-like molecules
| PDB/AF Accession | PyMOL script | Experimental / Predicted | Interacting ECOD domains | ECOD X-group name | LigPlot |
|---|---|---|---|---|---|
| 7W2R | Download | Experimental | e7w2rB1 e7w2rU1 e7w2rW1 e7w2rs1 e7w2rU1 e7w2rj1 e7w2rs1 | 4Fe-4S ferredoxin Mitochondrial complex I, B9 subunit Mitochondrial complex I, B16.6 subunit Sodium/proton antiporter subunits-like Mitochondrial complex I, B9 subunit NADH-quinone oxidoreductase subunit A Sodium/proton antiporter subunits-like | LigPlot |
| 7VC0 | Download | Experimental | e7vc0U1 e7vc0W1 e7vc0s1 e7vc0U1 e7vc0j1 e7vc0s1 | Mitochondrial complex I, B9 subunit Mitochondrial complex I, B16.6 subunit Sodium/proton antiporter subunits-like Mitochondrial complex I, B9 subunit NADH-quinone oxidoreductase subunit A Sodium/proton antiporter subunits-like | LigPlot |
| 7V31 | Download | Experimental | e7v31B1 e7v31U1 e7v31W1 e7v31s1 e7v31U1 e7v31j1 e7v31s1 | 4Fe-4S ferredoxin Mitochondrial complex I, B9 subunit Mitochondrial complex I, B16.6 subunit Sodium/proton antiporter subunits-like Mitochondrial complex I, B9 subunit NADH-quinone oxidoreductase subunit A Sodium/proton antiporter subunits-like | LigPlot |
| 7VYI | Download | Experimental | e7vyiU1 e7vyiW1 e7vyis1 | Mitochondrial complex I, B9 subunit Mitochondrial complex I, B16.6 subunit Sodium/proton antiporter subunits-like | LigPlot |
| 7W00 | Download | Experimental | e7w00B1 e7w00U1 e7w00W1 e7w00s1 e7w00U1 e7w00j1 e7w00s1 | 4Fe-4S ferredoxin Mitochondrial complex I, B9 subunit Mitochondrial complex I, B16.6 subunit Sodium/proton antiporter subunits-like Mitochondrial complex I, B9 subunit NADH-quinone oxidoreductase subunit A Sodium/proton antiporter subunits-like | LigPlot |
| 7W0R | Download | Experimental | e7w0rB1 e7w0rU1 e7w0rW1 e7w0rs1 | 4Fe-4S ferredoxin Mitochondrial complex I, B9 subunit Mitochondrial complex I, B16.6 subunit Sodium/proton antiporter subunits-like | LigPlot |
| 7V2C | Download | Experimental | e7v2cU1 e7v2cW1 e7v2cs1 e7v2cB1 | Mitochondrial complex I, B9 subunit Mitochondrial complex I, B16.6 subunit Sodium/proton antiporter subunits-like 4Fe-4S ferredoxin | LigPlot |
| 7V2F | Download | Experimental | e7v2fU1 e7v2fj1 e7v2fs1 e7v2fB1 e7v2fU1 e7v2fW1 e7v2fs1 | Mitochondrial complex I, B9 subunit NADH-quinone oxidoreductase subunit A Sodium/proton antiporter subunits-like 4Fe-4S ferredoxin Mitochondrial complex I, B9 subunit Mitochondrial complex I, B16.6 subunit Sodium/proton antiporter subunits-like | LigPlot |
| 7VBP | Download | Experimental | e7vbpU1 e7vbpj1 e7vbps1 e7vbpU1 e7vbpW1 e7vbps1 | Mitochondrial complex I, B9 subunit NADH-quinone oxidoreductase subunit A Sodium/proton antiporter subunits-like Mitochondrial complex I, B9 subunit Mitochondrial complex I, B16.6 subunit Sodium/proton antiporter subunits-like | LigPlot |
| 7W0H | Download | Experimental | e7w0hB1 e7w0hU1 e7w0hW1 e7w0hs1 e7w0hU1 e7w0hj1 e7w0hs1 | 4Fe-4S ferredoxin Mitochondrial complex I, B9 subunit Mitochondrial complex I, B16.6 subunit Sodium/proton antiporter subunits-like Mitochondrial complex I, B9 subunit NADH-quinone oxidoreductase subunit A Sodium/proton antiporter subunits-like | LigPlot |
| 7W1P | Download | Experimental | e7w1pB1 e7w1pU1 e7w1pW1 e7w1ps1 e7w1pU1 e7w1pj1 e7w1ps1 | 4Fe-4S ferredoxin Mitochondrial complex I, B9 subunit Mitochondrial complex I, B16.6 subunit Sodium/proton antiporter subunits-like Mitochondrial complex I, B9 subunit NADH-quinone oxidoreductase subunit A Sodium/proton antiporter subunits-like | LigPlot |
| 7V2R | Download | Experimental | e7v2rB1 e7v2rU1 e7v2rW1 e7v2rs1 | 4Fe-4S ferredoxin Mitochondrial complex I, B9 subunit Mitochondrial complex I, B16.6 subunit Sodium/proton antiporter subunits-like | LigPlot |
| 7W1O | Download | Experimental | e7w1oB1 e7w1oU1 e7w1oW1 e7w1os1 e7w1oU1 e7w1oj1 e7w1os1 | 4Fe-4S ferredoxin Mitochondrial complex I, B9 subunit Mitochondrial complex I, B16.6 subunit Sodium/proton antiporter subunits-like Mitochondrial complex I, B9 subunit NADH-quinone oxidoreductase subunit A Sodium/proton antiporter subunits-like | LigPlot |
| 7V2H | Download | Experimental | e7v2hU1 e7v2hj1 e7v2hs1 e7v2hB1 e7v2hU1 e7v2hW1 e7v2hs1 | Mitochondrial complex I, B9 subunit NADH-quinone oxidoreductase subunit A Sodium/proton antiporter subunits-like 4Fe-4S ferredoxin Mitochondrial complex I, B9 subunit Mitochondrial complex I, B16.6 subunit Sodium/proton antiporter subunits-like | LigPlot |
| 7VZW | Download | Experimental | e7vzwB1 e7vzwU1 e7vzwW1 e7vzws1 e7vzwU1 e7vzwj1 e7vzws1 | 4Fe-4S ferredoxin Mitochondrial complex I, B9 subunit Mitochondrial complex I, B16.6 subunit Sodium/proton antiporter subunits-like Mitochondrial complex I, B9 subunit NADH-quinone oxidoreductase subunit A Sodium/proton antiporter subunits-like | LigPlot |
| 7W4G | Download | Experimental | e7w4gB1 e7w4gU1 e7w4gW1 e7w4gs1 e7w4gU1 e7w4gj1 e7w4gs1 | 4Fe-4S ferredoxin Mitochondrial complex I, B9 subunit Mitochondrial complex I, B16.6 subunit Sodium/proton antiporter subunits-like Mitochondrial complex I, B9 subunit NADH-quinone oxidoreductase subunit A Sodium/proton antiporter subunits-like | LigPlot |
| 7V2D | Download | Experimental | e7v2dB1 e7v2dU1 e7v2dW1 e7v2ds1 e7v2dU1 e7v2dj1 e7v2ds1 | 4Fe-4S ferredoxin Mitochondrial complex I, B9 subunit Mitochondrial complex I, B16.6 subunit Sodium/proton antiporter subunits-like Mitochondrial complex I, B9 subunit NADH-quinone oxidoreductase subunit A Sodium/proton antiporter subunits-like | LigPlot |
| 7W20 | Download | Experimental | e7w20B1 e7w20U1 e7w20W1 e7w20s1 e7w20U1 e7w20j1 e7w20s1 | 4Fe-4S ferredoxin Mitochondrial complex I, B9 subunit Mitochondrial complex I, B16.6 subunit Sodium/proton antiporter subunits-like Mitochondrial complex I, B9 subunit NADH-quinone oxidoreductase subunit A Sodium/proton antiporter subunits-like | LigPlot |
| 7VZ8 | Download | Experimental | e7vz8U1 e7vz8j1 e7vz8s1 e7vz8U1 e7vz8W1 e7vz8s1 | Mitochondrial complex I, B9 subunit NADH-quinone oxidoreductase subunit A Sodium/proton antiporter subunits-like Mitochondrial complex I, B9 subunit Mitochondrial complex I, B16.6 subunit Sodium/proton antiporter subunits-like | LigPlot |
| 7W1Z | Download | Experimental | e7w1zB1 e7w1zU1 e7w1zW1 e7w1zs1 | 4Fe-4S ferredoxin Mitochondrial complex I, B9 subunit Mitochondrial complex I, B16.6 subunit Sodium/proton antiporter subunits-like | LigPlot |
| 7V33 | Download | Experimental | e7v33B1 e7v33U1 e7v33W1 e7v33s1 e7v33U1 e7v33j1 e7v33s1 | 4Fe-4S ferredoxin Mitochondrial complex I, B9 subunit Mitochondrial complex I, B16.6 subunit Sodium/proton antiporter subunits-like Mitochondrial complex I, B9 subunit NADH-quinone oxidoreductase subunit A Sodium/proton antiporter subunits-like | LigPlot |
| 7W2L | Download | Experimental | e7w2lB1 e7w2lU1 e7w2lW1 e7w2ls1 e7w2lU1 e7w2lj1 e7w2ls1 | 4Fe-4S ferredoxin Mitochondrial complex I, B9 subunit Mitochondrial complex I, B16.6 subunit Sodium/proton antiporter subunits-like Mitochondrial complex I, B9 subunit NADH-quinone oxidoreductase subunit A Sodium/proton antiporter subunits-like | LigPlot |
| 7W0Y | Download | Experimental | e7w0yB1 e7w0yU1 e7w0yW1 e7w0ys1 e7w0yU1 e7w0yj1 e7w0ys1 | 4Fe-4S ferredoxin Mitochondrial complex I, B9 subunit Mitochondrial complex I, B16.6 subunit Sodium/proton antiporter subunits-like Mitochondrial complex I, B9 subunit NADH-quinone oxidoreductase subunit A Sodium/proton antiporter subunits-like | LigPlot |
| 7VZV | Download | Experimental | e7vzvB1 e7vzvU1 e7vzvW1 e7vzvs1 | 4Fe-4S ferredoxin Mitochondrial complex I, B9 subunit Mitochondrial complex I, B16.6 subunit Sodium/proton antiporter subunits-like | LigPlot |
| 7W2Y | Download | Experimental | e7w2yB1 e7w2yU1 e7w2yW1 e7w2ys1 | 4Fe-4S ferredoxin Mitochondrial complex I, B9 subunit Mitochondrial complex I, B16.6 subunit Sodium/proton antiporter subunits-like | LigPlot |
| 7V2E | Download | Experimental | e7v2eB1 e7v2eU1 e7v2eW1 e7v2es1 | 4Fe-4S ferredoxin Mitochondrial complex I, B9 subunit Mitochondrial complex I, B16.6 subunit Sodium/proton antiporter subunits-like | LigPlot |
| 7VWL | Download | Experimental | e7vwlU1 e7vwlj1 e7vwls1 e7vwlU1 e7vwlW1 e7vwls1 | Mitochondrial complex I, B9 subunit NADH-quinone oxidoreductase subunit A Sodium/proton antiporter subunits-like Mitochondrial complex I, B9 subunit Mitochondrial complex I, B16.6 subunit Sodium/proton antiporter subunits-like | LigPlot |
| 7V32 | Download | Experimental | e7v32B1 e7v32U1 e7v32W1 e7v32s1 e7v32U1 e7v32j1 e7v32s1 | 4Fe-4S ferredoxin Mitochondrial complex I, B9 subunit Mitochondrial complex I, B16.6 subunit Sodium/proton antiporter subunits-like Mitochondrial complex I, B9 subunit NADH-quinone oxidoreductase subunit A Sodium/proton antiporter subunits-like | LigPlot |
| 7W1U | Download | Experimental | e7w1uB1 e7w1uU1 e7w1uW1 e7w1us1 e7w1uU1 e7w1uj1 e7w1us1 | 4Fe-4S ferredoxin Mitochondrial complex I, B9 subunit Mitochondrial complex I, B16.6 subunit Sodium/proton antiporter subunits-like Mitochondrial complex I, B9 subunit NADH-quinone oxidoreductase subunit A Sodium/proton antiporter subunits-like | LigPlot |
| 7W4C | Download | Experimental | e7w4cB1 e7w4cU1 e7w4cW1 e7w4cs1 e7w4cU1 e7w4cj1 e7w4cs1 | 4Fe-4S ferredoxin Mitochondrial complex I, B9 subunit Mitochondrial complex I, B16.6 subunit Sodium/proton antiporter subunits-like Mitochondrial complex I, B9 subunit NADH-quinone oxidoreductase subunit A Sodium/proton antiporter subunits-like | LigPlot |
| 7W4L | Download | Experimental | e7w4lB1 e7w4lU1 e7w4lW1 e7w4ls1 e7w4lU1 e7w4lj1 e7w4ls1 | 4Fe-4S ferredoxin Mitochondrial complex I, B9 subunit Mitochondrial complex I, B16.6 subunit Sodium/proton antiporter subunits-like Mitochondrial complex I, B9 subunit NADH-quinone oxidoreductase subunit A Sodium/proton antiporter subunits-like | LigPlot |
| 7VYE | Download | Experimental | e7vyeU1 e7vyej1 e7vyes1 e7vyeU1 e7vyeW1 e7vyes1 | Mitochondrial complex I, B9 subunit NADH-quinone oxidoreductase subunit A Sodium/proton antiporter subunits-like Mitochondrial complex I, B9 subunit Mitochondrial complex I, B16.6 subunit Sodium/proton antiporter subunits-like | LigPlot |
| 7W4E | Download | Experimental | e7w4eB1 e7w4eU1 e7w4eW1 e7w4es1 | 4Fe-4S ferredoxin Mitochondrial complex I, B9 subunit Mitochondrial complex I, B16.6 subunit Sodium/proton antiporter subunits-like | LigPlot |
| 7V2K | Download | Experimental | e7v2kU1 e7v2kj1 e7v2ks1 e7v2kB1 e7v2kU1 e7v2kW1 e7v2ks1 | Mitochondrial complex I, B9 subunit NADH-quinone oxidoreductase subunit A Sodium/proton antiporter subunits-like 4Fe-4S ferredoxin Mitochondrial complex I, B9 subunit Mitochondrial complex I, B16.6 subunit Sodium/proton antiporter subunits-like | LigPlot |
| 7W1V | Download | Experimental | e7w1vB1 e7w1vU1 e7w1vW1 e7w1vs1 e7w1vU1 e7w1vj1 e7w1vs1 | 4Fe-4S ferredoxin Mitochondrial complex I, B9 subunit Mitochondrial complex I, B16.6 subunit Sodium/proton antiporter subunits-like Mitochondrial complex I, B9 subunit NADH-quinone oxidoreductase subunit A Sodium/proton antiporter subunits-like | LigPlot |
| 7W4M | Download | Experimental | e7w4mB1 e7w4mU1 e7w4mW1 e7w4ms1 e7w4mU1 e7w4mj1 e7w4ms1 | 4Fe-4S ferredoxin Mitochondrial complex I, B9 subunit Mitochondrial complex I, B16.6 subunit Sodium/proton antiporter subunits-like Mitochondrial complex I, B9 subunit NADH-quinone oxidoreductase subunit A Sodium/proton antiporter subunits-like | LigPlot |
| 7VXS | Download | Experimental | e7vxsU1 e7vxsj1 e7vxss1 e7vxsU1 e7vxsW1 e7vxss1 | Mitochondrial complex I, B9 subunit NADH-quinone oxidoreductase subunit A Sodium/proton antiporter subunits-like Mitochondrial complex I, B9 subunit Mitochondrial complex I, B16.6 subunit Sodium/proton antiporter subunits-like | LigPlot |
| 7V30 | Download | Experimental | e7v30U1 e7v30j1 e7v30s1 e7v30B1 e7v30U1 e7v30W1 e7v30s1 | Mitochondrial complex I, B9 subunit NADH-quinone oxidoreductase subunit A Sodium/proton antiporter subunits-like 4Fe-4S ferredoxin Mitochondrial complex I, B9 subunit Mitochondrial complex I, B16.6 subunit Sodium/proton antiporter subunits-like | LigPlot |
| 7W4J | Download | Experimental | e7w4jU1 e7w4jj1 e7w4js1 e7w4jB1 e7w4jU1 e7w4jW1 e7w4js1 | Mitochondrial complex I, B9 subunit NADH-quinone oxidoreductase subunit A Sodium/proton antiporter subunits-like 4Fe-4S ferredoxin Mitochondrial complex I, B9 subunit Mitochondrial complex I, B16.6 subunit Sodium/proton antiporter subunits-like | LigPlot |
| 7W4Q | Download | Experimental | e7w4qB1 e7w4qU1 e7w4qW1 e7w4qs1 e7w4qU1 e7w4qj1 e7w4qs1 | 4Fe-4S ferredoxin Mitochondrial complex I, B9 subunit Mitochondrial complex I, B16.6 subunit Sodium/proton antiporter subunits-like Mitochondrial complex I, B9 subunit NADH-quinone oxidoreductase subunit A Sodium/proton antiporter subunits-like | LigPlot |
| 7VY9 | Download | Experimental | e7vy9U1 e7vy9j1 e7vy9s1 e7vy9U1 e7vy9W1 e7vy9s1 | Mitochondrial complex I, B9 subunit NADH-quinone oxidoreductase subunit A Sodium/proton antiporter subunits-like Mitochondrial complex I, B9 subunit Mitochondrial complex I, B16.6 subunit Sodium/proton antiporter subunits-like | LigPlot |
| 7W32 | Download | Experimental | e7w32B1 e7w32U1 e7w32W1 e7w32s1 e7w32U1 e7w32j1 e7w32s1 | 4Fe-4S ferredoxin Mitochondrial complex I, B9 subunit Mitochondrial complex I, B16.6 subunit Sodium/proton antiporter subunits-like Mitochondrial complex I, B9 subunit NADH-quinone oxidoreductase subunit A Sodium/proton antiporter subunits-like | LigPlot |
| 7VBL | Download | Experimental | e7vblU1 e7vblW1 e7vbls1 | Mitochondrial complex I, B9 subunit Mitochondrial complex I, B16.6 subunit Sodium/proton antiporter subunits-like | LigPlot |
| 7W4N | Download | Experimental | e7w4nB1 e7w4nU1 e7w4nW1 e7w4ns1 e7w4nU1 e7w4nj1 e7w4ns1 | 4Fe-4S ferredoxin Mitochondrial complex I, B9 subunit Mitochondrial complex I, B16.6 subunit Sodium/proton antiporter subunits-like Mitochondrial complex I, B9 subunit NADH-quinone oxidoreductase subunit A Sodium/proton antiporter subunits-like | LigPlot |
| 7VYS | Download | Experimental | e7vysU1 e7vysW1 e7vyss1 | Mitochondrial complex I, B9 subunit Mitochondrial complex I, B16.6 subunit Sodium/proton antiporter subunits-like | LigPlot |
| 7W35 | Download | Experimental | e7w35B1 e7w35U1 e7w35W1 e7w35s1 e7w35U1 e7w35j1 e7w35s1 | 4Fe-4S ferredoxin Mitochondrial complex I, B9 subunit Mitochondrial complex I, B16.6 subunit Sodium/proton antiporter subunits-like Mitochondrial complex I, B9 subunit NADH-quinone oxidoreductase subunit A Sodium/proton antiporter subunits-like | LigPlot |
| 7W4F | Download | Experimental | e7w4fB1 e7w4fU1 e7w4fW1 e7w4fs1 e7w4fU1 e7w4fj1 e7w4fs1 | 4Fe-4S ferredoxin Mitochondrial complex I, B9 subunit Mitochondrial complex I, B16.6 subunit Sodium/proton antiporter subunits-like Mitochondrial complex I, B9 subunit NADH-quinone oxidoreductase subunit A Sodium/proton antiporter subunits-like | LigPlot |
| 7V3M | Download | Experimental | e7v3mB1 e7v3mU1 e7v3mW1 e7v3ms1 e7v3mU1 e7v3mj1 e7v3ms1 | 4Fe-4S ferredoxin Mitochondrial complex I, B9 subunit Mitochondrial complex I, B16.6 subunit Sodium/proton antiporter subunits-like Mitochondrial complex I, B9 subunit NADH-quinone oxidoreductase subunit A Sodium/proton antiporter subunits-like | LigPlot |
| 7VYG | Download | Experimental | e7vygU1 e7vygW1 e7vygs1 | Mitochondrial complex I, B9 subunit Mitochondrial complex I, B16.6 subunit Sodium/proton antiporter subunits-like | LigPlot |
| 7W31 | Download | Experimental | e7w31B1 e7w31U1 e7w31W1 e7w31s1 e7w31U1 e7w31j1 e7w31s1 | 4Fe-4S ferredoxin Mitochondrial complex I, B9 subunit Mitochondrial complex I, B16.6 subunit Sodium/proton antiporter subunits-like Mitochondrial complex I, B9 subunit NADH-quinone oxidoreductase subunit A Sodium/proton antiporter subunits-like | LigPlot |
| 7W1T | Download | Experimental | e7w1tB1 e7w1tU1 e7w1tW1 e7w1ts1 | 4Fe-4S ferredoxin Mitochondrial complex I, B9 subunit Mitochondrial complex I, B16.6 subunit Sodium/proton antiporter subunits-like | LigPlot |
| 7W2K | Download | Experimental | e7w2kB1 e7w2kU1 e7w2kW1 e7w2ks1 e7w2kU1 e7w2kj1 e7w2ks1 | 4Fe-4S ferredoxin Mitochondrial complex I, B9 subunit Mitochondrial complex I, B16.6 subunit Sodium/proton antiporter subunits-like Mitochondrial complex I, B9 subunit NADH-quinone oxidoreductase subunit A Sodium/proton antiporter subunits-like | LigPlot |
| 7W2U | Download | Experimental | e7w2uB1 e7w2uU1 e7w2uW1 e7w2us1 | 4Fe-4S ferredoxin Mitochondrial complex I, B9 subunit Mitochondrial complex I, B16.6 subunit Sodium/proton antiporter subunits-like | LigPlot |
| 7W4K | Download | Experimental | e7w4kB1 e7w4kU1 e7w4kW1 e7w4ks1 e7w4kU1 e7w4kj1 e7w4ks1 | 4Fe-4S ferredoxin Mitochondrial complex I, B9 subunit Mitochondrial complex I, B16.6 subunit Sodium/proton antiporter subunits-like Mitochondrial complex I, B9 subunit NADH-quinone oxidoreductase subunit A Sodium/proton antiporter subunits-like | LigPlot |