PDB ligand accession: KC1
DrugBank: n/a
PubChem: n/a
ChEMBL: n/a
InChI Key: DGNIJJSSARBJSH-QIEHNWLWSA-L
SMILES: CCC1=C(c2cc3c(c(c4n3[Mg]n5c(cc1n2)c(c6c5c(c7nc(c4)C(=C7C=CC(=O)O)C)C(C6=O)C(=O)OC)C)C)C=C)C
Drug action: n/a
| PDB/AF Accession | PyMOL script | Experimental / Predicted | Interacting ECOD domains | ECOD X-group name | LigPlot |
|---|---|---|---|---|---|
| 6LY5 | Download | Experimental | e6ly5K1 e6ly5L1 e6ly5L1 e6ly5L1 e6ly5P1 e6ly5Q1 | Chlorophyll a-b binding protein Chlorophyll a-b binding protein Chlorophyll a-b binding protein Chlorophyll a-b binding protein Chlorophyll a-b binding protein Chlorophyll a-b binding protein | LigPlot |