PDB ligand accession: DD6
DrugBank: n/a
PubChem:
ChEMBL: n/a
InChI Key: OGHZCSINIMWCSB-WMTIXGNLSA-N
SMILES: CC1=C(C(CC(C1)O)(C)C)C#CC(=CC=CC(=CC=CC=C(C)C=CC=C(C)C=CC23C(CC(CC2(O3)C)O)(C)C)C)C
Drug action: n/a
| PDB/AF Accession | PyMOL script | Experimental / Predicted | Interacting ECOD domains | ECOD X-group name | LigPlot |
|---|---|---|---|---|---|
| 6LY5 | Download | Experimental | e6ly5O1 e6ly5P1 e6ly5Q1 | Chlorophyll a-b binding protein Chlorophyll a-b binding protein Chlorophyll a-b binding protein | LigPlot |