PDB ligand accession: U10
DrugBank: DB09270
PubChem:
ChEMBL:
InChI Key: ACTIUHUUMQJHFO-UPTCCGCDSA-N
SMILES: CC1=C(C(=O)C(=C(C1=O)OC)OC)CC=C(C)CCC=C(C)CCC=C(C)CCC=C(C)CCC=C(C)CCC=C(C)CCC=C(C)CCC=C(C)CCC=C(C)CCC=C(C)C
Drug action: n/a
ClassyFire chemical classification:
- Kingdom: Organic compounds
- Superclass: Lipids and lipid-like molecules
- Class: Prenol lipids
- Subclass: Quinone and hydroquinone lipids
- Class: Prenol lipids
- Superclass: Lipids and lipid-like molecules
| PDB/AF Accession | PyMOL script | Experimental / Predicted | Interacting ECOD domains | ECOD X-group name | LigPlot |
|---|---|---|---|---|---|
| 7VY3 | Download | Experimental | e7vy3L1 e7vy3M1 e7vy3L1 e7vy3M1 e7vy3D1 e7vy3F1 e7vy3L1 e7vy3A1 e7vy3D1 e7vy3B1 e7vy3E1 e7vy3X1 | Bacterial photosystem II reaction centre L and M subunits-like Bacterial photosystem II reaction centre L and M subunits-like Bacterial photosystem II reaction centre L and M subunits-like Bacterial photosystem II reaction centre L and M subunits-like Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial photosystem II reaction centre L and M subunits-like Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Intrinsic membrane protein pufX | LigPlot |
| 7VY2 | Download | Experimental | e7vy2L1 e7vy2M1 e7vy2L1 e7vy2M1 e7vy2D1 e7vy2F1 e7vy2L1 e7vy2A1 e7vy2D1 e7vy2X1 e7vy2l1 e7vy2m1 e7vy2l1 e7vy2m1 e7vy2d1 e7vy2f1 e7vy2l1 e7vy2a1 e7vy2d1 e7vy2x1 | Bacterial photosystem II reaction centre L and M subunits-like Bacterial photosystem II reaction centre L and M subunits-like Bacterial photosystem II reaction centre L and M subunits-like Bacterial photosystem II reaction centre L and M subunits-like Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial photosystem II reaction centre L and M subunits-like Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Intrinsic membrane protein pufX Bacterial photosystem II reaction centre L and M subunits-like Bacterial photosystem II reaction centre L and M subunits-like Bacterial photosystem II reaction centre L and M subunits-like Bacterial photosystem II reaction centre L and M subunits-like Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial photosystem II reaction centre L and M subunits-like Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Intrinsic membrane protein pufX | LigPlot |