PDB ligand accession: BCL
DrugBank: DB01853
PubChem: 11953947;16057436;
ChEMBL: n/a
InChI Key: DSJXIQQMORJERS-AGGZHOMASA-M
SMILES: CCC1C(C2=CC3=C(C(=C4[N-]3[Mg+2]56[N]2=C1C=C7[N-]5C8=C(C(C(=O)C8=C7C)C(=O)OC)C9=[N]6C(=C4)C(C9CCC(=O)OCC=C(C)CCCC(C)CCCC(C)CCCC(C)C)C)C)C(=O)C)C
Drug action: n/a
ClassyFire chemical classification:
- Kingdom: Organic compounds
- Superclass: Organoheterocyclic compounds
- Class: Tetrapyrroles and derivatives
- Subclass: Metallotetrapyrroles
- Class: Tetrapyrroles and derivatives
- Superclass: Organoheterocyclic compounds
| PDB/AF Accession | PyMOL script | Experimental / Predicted | Interacting ECOD domains | ECOD X-group name | LigPlot |
|---|---|---|---|---|---|
| 7VY3 | Download | Experimental | e7vy3A1 e7vy3B1 e7vy3X1 e7vy3A1 e7vy3D1 e7vy3B1 e7vy3L1 e7vy3A1 e7vy3D1 e7vy3B1 e7vy3E1 e7vy3D1 e7vy3F1 e7vy3E1 e7vy3D1 e7vy3F1 e7vy3E1 e7vy3G1 e7vy3F1 e7vy3I1 e7vy3G1 e7vy3F1 e7vy3I1 e7vy3G1 e7vy3J1 e7vy3I1 e7vy3K1 e7vy3J1 e7vy3I1 e7vy3K1 e7vy3J1 e7vy3N1 e7vy3K1 e7vy3O1 e7vy3N1 e7vy3K1 e7vy3O1 e7vy3N1 e7vy3P1 e7vy3O1 e7vy3Q1 e7vy3P1 e7vy3Q1 e7vy3S1 e7vy3R1 e7vy3Q1 e7vy3S1 e7vy3R1 e7vy3T1 e7vy3S1 e7vy3V1 e7vy3T1 e7vy3S1 e7vy3V1 e7vy3T1 e7vy3W1 e7vy3V1 e7vy3Y1 e7vy3W1 e7vy3V1 e7vy3Y1 e7vy3W1 e7vy3Z1 e7vy3Y1 e7vy3Z1 e7vy3Y1 e7vy311 e7vy3Z1 | Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Intrinsic membrane protein pufX Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial photosystem II reaction centre L and M subunits-like Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits | LigPlot |
| 7VY2 | Download | Experimental | e7vy2A1 e7vy2a1 e7vy2B1 e7vy2X1 e7vy2A1 e7vy2D1 e7vy2B1 e7vy2L1 e7vy2A1 e7vy2D1 e7vy2B1 e7vy2E1 e7vy2D1 e7vy2F1 e7vy2E1 e7vy2D1 e7vy2F1 e7vy2E1 e7vy2G1 e7vy2F1 e7vy2I1 e7vy2G1 e7vy2F1 e7vy2I1 e7vy2G1 e7vy2J1 e7vy2I1 e7vy2K1 e7vy2J1 e7vy2I1 e7vy2K1 e7vy2J1 e7vy2N1 e7vy2K1 e7vy2O1 e7vy2N1 e7vy2K1 e7vy2O1 e7vy2N1 e7vy2P1 e7vy2O1 e7vy2Q1 e7vy2P1 e7vy2O1 e7vy2Q1 e7vy2P1 e7vy2R1 e7vy2Q1 e7vy2S1 e7vy2R1 e7vy2Q1 e7vy2S1 e7vy2R1 e7vy2T1 e7vy2S1 e7vy2V1 e7vy2T1 e7vy2S1 e7vy2V1 e7vy2T1 e7vy2W1 e7vy2V1 e7vy2Y1 e7vy2W1 e7vy2V1 e7vy2Y1 e7vy2W1 e7vy2Z1 e7vy2Y1 e7vy211 e7vy2Z1 e7vy2Y1 e7vy211 e7vy2Z1 e7vy221 e7vy211 e7vy231 e7vy221 e7vy211 e7vy231 e7vy221 e7vy241 e7vy231 e7vy251 e7vy241 e7vy231 e7vy251 e7vy241 e7vy261 e7vy251 e7vy271 e7vy261 e7vy251 e7vy271 e7vy261 e7vy281 e7vy271 e7vy281 e7vy2A1 e7vy2a1 e7vy2b1 e7vy2x1 e7vy2a1 e7vy2d1 e7vy2b1 e7vy2e1 e7vy2l1 e7vy2a1 e7vy2d1 e7vy2b1 e7vy2e1 e7vy2d1 e7vy2f1 e7vy2e1 e7vy2d1 e7vy2f1 e7vy2e1 e7vy2g1 e7vy2f1 e7vy2i1 e7vy2g1 e7vy2f1 e7vy2i1 e7vy2g1 e7vy2j1 e7vy2i1 e7vy2k1 e7vy2j1 e7vy2i1 e7vy2k1 e7vy2j1 e7vy2n1 e7vy2k1 e7vy2o1 e7vy2n1 e7vy2k1 e7vy2o1 e7vy2n1 e7vy2p1 e7vy2o1 e7vy2q1 e7vy2p1 e7vy2o1 e7vy2q1 e7vy2p1 e7vy2r1 e7vy2q1 e7vy2s1 e7vy2r1 e7vy2q1 e7vy2s1 e7vy2r1 e7vy2t1 e7vy2s1 e7vy2v1 e7vy2t1 e7vy2s1 e7vy2v1 e7vy2t1 e7vy2w1 e7vy2v1 e7vy2y1 e7vy2w1 e7vy2v1 e7vy2y1 e7vy2w1 e7vy2z1 e7vy2y1 e7vy2011 e7vy2z1 e7vy2y1 e7vy2011 e7vy2z1 e7vy2021 e7vy2011 e7vy2031 e7vy2021 e7vy2011 e7vy2031 e7vy2021 e7vy2041 e7vy2031 e7vy2051 e7vy2041 e7vy2031 e7vy2051 e7vy2041 e7vy2061 e7vy2051 e7vy2071 e7vy2061 e7vy2051 e7vy2071 e7vy2061 e7vy2081 e7vy2071 e7vy2081 | Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Intrinsic membrane protein pufX Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial photosystem II reaction centre L and M subunits-like Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Intrinsic membrane protein pufX Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial photosystem II reaction centre L and M subunits-like Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits | LigPlot |