Ligand name: SPIRILLOXANTHIN
PDB ligand accession: CRT
DrugBank: n/a
PubChem: 5287981
ChEMBL: n/a
InChI Key: VAZQBTJCYODOSV-RISZBRKMSA-N
SMILES: CC(=CC=CC(=CC=CC(=CC=CC=C(C)C=CC=C(C)C=CC=C(C)C=CCC(C)(C)OC)C)C)C=CCC(C)(C)OC
Drug action: n/a

ClassyFire chemical classification:

• Kingdom: Organic compounds
  • Superclass: Lipids and lipid-like molecules
    • Class: Prenol lipids
      • Subclass: Tetraterpenoids

List of PDB structures and/or AlphaFold models with target protein A8ASG6

PDB/AF Accession	PyMOL script	Experimental / Predicted	Interacting ECOD domains	ECOD X-group name	LigPlot
5B5M	Download	Experimental	e5b5mM1 e5b5mO1 e5b5mQ1 e5b5mM1 e5b5mS1 e5b5mU1 e5b5mW1 e5b5mV1 e5b5my1 e5b5mAA1 e5b5mAC1 e5b5my1 e5b5mAE1 e5b5mAG1 e5b5mAI1 e5b5mAH1	Bacterial photosystem II reaction centre L and M subunits-like Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial photosystem II reaction centre L and M subunits-like Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial photosystem II reaction centre L and M subunits-like Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial photosystem II reaction centre L and M subunits-like Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits	LigPlot
7C52	Download	Experimental	e7c52M1 e7c52O1 e7c52Q1 e7c52M1 e7c52U1 e7c52S1 e7c52W1 e7c52V1	Bacterial photosystem II reaction centre L and M subunits-like Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial photosystem II reaction centre L and M subunits-like Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits	LigPlot
5Y5S	Download	Experimental	e5y5sM1 e5y5sO1 e5y5sQ1 e5y5sM1 e5y5sU1 e5y5sS1 e5y5sW1 e5y5sV1	Bacterial photosystem II reaction centre L and M subunits-like Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial photosystem II reaction centre L and M subunits-like Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits	LigPlot
4V8K	Download	Experimental	e4v8kAM1 e4v8kAO1 e4v8kAQ1 e4v8kAS1 e4v8kAM1 e4v8kAS1 e4v8kAU1 e4v8kAW1 e4v8kAT1 e4v8kAV1 e4v8kBM1 e4v8kBO1 e4v8kBQ1 e4v8kBM1 e4v8kBS1 e4v8kBU1 e4v8kBW1 e4v8kBV1	Bacterial photosystem II reaction centre L and M subunits-like Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial photosystem II reaction centre L and M subunits-like Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial photosystem II reaction centre L and M subunits-like Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial photosystem II reaction centre L and M subunits-like Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits	LigPlot
3WMM	Download	Experimental	e3wmmM1 e3wmmO1 e3wmmQ1 e3wmmM1 e3wmmT1 e3wmmV1 e3wmmS1 e3wmmU1 e3wmmW1	Bacterial photosystem II reaction centre L and M subunits-like Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial photosystem II reaction centre L and M subunits-like Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits	LigPlot
5B5N	Download	Experimental	e5b5nM1 e5b5nO1 e5b5nQ1 e5b5nS1 e5b5nM1 e5b5nS1 e5b5nU1 e5b5nW1 e5b5nV1 e5b5ny1 e5b5nAA1 e5b5nAC1 e5b5ny1 e5b5nAE1 e5b5nAG1 e5b5nAI1 e5b5nAH1	Bacterial photosystem II reaction centre L and M subunits-like Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial photosystem II reaction centre L and M subunits-like Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial photosystem II reaction centre L and M subunits-like Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial photosystem II reaction centre L and M subunits-like Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits	LigPlot