PDB ligand accession: 8CT
DrugBank: n/a
PubChem:
ChEMBL: n/a
InChI Key: ANVAOWXLWRTKGA-GZSHKXEASA-N
SMILES: CC1=C(C(CCC1)(C)C)C=CC(=CC=CC(=CC=CC=C(C)C=CC=C(C)C=CC2C(=CCCC2(C)C)C)C)C
Drug action: n/a
| PDB/AF Accession | PyMOL script | Experimental / Predicted | Interacting ECOD domains | ECOD X-group name | LigPlot |
|---|---|---|---|---|---|
| 7YMM | Download | Experimental | e7ymm1A1 e7ymm1I1 e7ymm2A1 e7ymm2I1 e7ymm3A1 e7ymm3I1 e7ymm4A1 e7ymm4I1 | Bacterial photosystem II reaction centre L and M subunits-like Photosystem II reaction center protein I, PsbI Bacterial photosystem II reaction centre L and M subunits-like Photosystem II reaction center protein I, PsbI Bacterial photosystem II reaction centre L and M subunits-like Photosystem II reaction center protein I, PsbI Bacterial photosystem II reaction centre L and M subunits-like Photosystem II reaction center protein I, PsbI | LigPlot |
| 7YMI | Download | Experimental | e7ymiA1 e7ymiI1 e7ymia1 e7ymii1 | Bacterial photosystem II reaction centre L and M subunits-like Photosystem II reaction center protein I, PsbI Bacterial photosystem II reaction centre L and M subunits-like Photosystem II reaction center protein I, PsbI | LigPlot |