Ligand name: N-[5-[2-(2-cyanopropan-2-yl)pyridin-4-yl]-4-(trifluoromethyl)-1,3-thiazol-2-yl]-4,6-dimethoxy-pyrimidine-5-carboxamide
PDB ligand accession: EQK
DrugBank: n/a
PubChem: 122589101
ChEMBL: n/a
InChI Key: CPIDEBBXBVMQOC-UHFFFAOYSA-N
SMILES: CC(C)(C#N)c1cc(ccn1)c2c(nc(s2)NC(=O)c3c(ncnc3OC)OC)C(F)(F)F
Drug action: n/a

List of PDB structures and/or AlphaFold models with target protein B2KYM6

PDB/AF Accession	PyMOL script	Experimental / Predicted	Interacting ECOD domains	ECOD X-group name	LigPlot
7XJ2	Download	Experimental	e7xj2B1 e7xj2C1 e7xj2C1 e7xj2D2 e7xj2B1 e7xj2A1 e7xj2A1 e7xj2D2	Voltage-gated ion channels Voltage-gated ion channels Voltage-gated ion channels Voltage-gated ion channels Voltage-gated ion channels Voltage-gated ion channels Voltage-gated ion channels Voltage-gated ion channels	LigPlot
7XJ1	Download	Experimental	e7xj1B2 e7xj1A2 e7xj1C2 e7xj1D2 e7xj1A2 e7xj1D2 e7xj1C2 e7xj1A2 e7xj1D2	Voltage-gated ion channels Voltage-gated ion channels Voltage-gated ion channels Voltage-gated ion channels Voltage-gated ion channels Voltage-gated ion channels Voltage-gated ion channels Voltage-gated ion channels Voltage-gated ion channels	LigPlot
7XJ0	Download	Experimental	e7xj0B1 e7xj0A1 e7xj0B1 e7xj0C2 e7xj0A1 e7xj0D1 e7xj0C2 e7xj0D1	Voltage-gated ion channels Voltage-gated ion channels Voltage-gated ion channels Voltage-gated ion channels Voltage-gated ion channels Voltage-gated ion channels Voltage-gated ion channels Voltage-gated ion channels	LigPlot