PDB ligand accession: BOG
DrugBank: n/a
PubChem:
ChEMBL:
InChI Key: HEGSGKPQLMEBJL-RKQHYHRCSA-N
SMILES: CCCCCCCCOC1C(C(C(C(O1)CO)O)O)O
Drug action: n/a
ClassyFire chemical classification:
- Kingdom: Organic compounds
- Superclass: Lipids and lipid-like molecules
- Class: Fatty Acyls
- Subclass: Fatty acyl glycosides
- Class: Fatty Acyls
- Superclass: Lipids and lipid-like molecules
| PDB/AF Accession | PyMOL script | Experimental / Predicted | Interacting ECOD domains | ECOD X-group name | LigPlot |
|---|---|---|---|---|---|
| 3L74 | Download | Experimental | e3l74C2 e3l74D1 e3l74D2 e3l74J1 e3l74Q2 e3l74W1 | Transmembrane heme-binding four-helical bundle Cytochrome c-like cytochrome c1 transmembrane anchor Subunit X (non-heme 7 kDa protein) of cytochrome bc1 complex (Ubiquinol-cytochrome c reductase) cytochrome c1 transmembrane anchor Subunit X (non-heme 7 kDa protein) of cytochrome bc1 complex (Ubiquinol-cytochrome c reductase) | LigPlot |
| 3L73 | Download | Experimental | e3l73C2 e3l73D2 e3l73J1 | Transmembrane heme-binding four-helical bundle cytochrome c1 transmembrane anchor Subunit X (non-heme 7 kDa protein) of cytochrome bc1 complex (Ubiquinol-cytochrome c reductase) | LigPlot |
| 3L72 | Download | Experimental | e3l72C2 e3l72D2 e3l72J1 | Transmembrane heme-binding four-helical bundle cytochrome c1 transmembrane anchor Subunit X (non-heme 7 kDa protein) of cytochrome bc1 complex (Ubiquinol-cytochrome c reductase) | LigPlot |
| 3H1H | Download | Experimental | e3h1hD1 e3h1hD2 e3h1hJ1 | Cytochrome c-like cytochrome c1 transmembrane anchor Subunit X (non-heme 7 kDa protein) of cytochrome bc1 complex (Ubiquinol-cytochrome c reductase) | LigPlot |
| 3L75 | Download | Experimental | e3l75C2 e3l75D1 e3l75D2 e3l75J1 e3l75Q2 e3l75W1 | Transmembrane heme-binding four-helical bundle Cytochrome c-like cytochrome c1 transmembrane anchor Subunit X (non-heme 7 kDa protein) of cytochrome bc1 complex (Ubiquinol-cytochrome c reductase) cytochrome c1 transmembrane anchor Subunit X (non-heme 7 kDa protein) of cytochrome bc1 complex (Ubiquinol-cytochrome c reductase) | LigPlot |
| 3TGU | Download | Experimental | e3tguC2 e3tguD2 e3tguJ1 | Transmembrane heme-binding four-helical bundle cytochrome c1 transmembrane anchor Subunit X (non-heme 7 kDa protein) of cytochrome bc1 complex (Ubiquinol-cytochrome c reductase) | LigPlot |
| 3CWB | Download | Experimental | e3cwbQ2 e3cwbW1 | cytochrome c1 transmembrane anchor Subunit X (non-heme 7 kDa protein) of cytochrome bc1 complex (Ubiquinol-cytochrome c reductase) | LigPlot |
| 4U3F | Download | Experimental | e4u3fC1 e4u3fD1 e4u3fJ1 e4u3fE3 e4u3fP2 e4u3fQ2 e4u3fW1 e4u3fR2 e4u3fR3 | Transmembrane heme-binding four-helical bundle cytochrome c1 transmembrane anchor Subunit X (non-heme 7 kDa protein) of cytochrome bc1 complex (Ubiquinol-cytochrome c reductase) iron-sulfur subunit (ISP) transmembrane anchor Transmembrane heme-binding four-helical bundle cytochrome c1 transmembrane anchor Subunit X (non-heme 7 kDa protein) of cytochrome bc1 complex (Ubiquinol-cytochrome c reductase) iron-sulfur subunit (ISP) transmembrane anchor ISP domain | LigPlot |
| 3L70 | Download | Experimental | e3l70C2 e3l70D2 e3l70J1 | Transmembrane heme-binding four-helical bundle cytochrome c1 transmembrane anchor Subunit X (non-heme 7 kDa protein) of cytochrome bc1 complex (Ubiquinol-cytochrome c reductase) | LigPlot |
| 3L71 | Download | Experimental | e3l71C2 e3l71D2 e3l71J1 | Transmembrane heme-binding four-helical bundle cytochrome c1 transmembrane anchor Subunit X (non-heme 7 kDa protein) of cytochrome bc1 complex (Ubiquinol-cytochrome c reductase) | LigPlot |