PDB ligand accession: CRT
DrugBank: n/a
PubChem:
ChEMBL: n/a
InChI Key: VAZQBTJCYODOSV-RISZBRKMSA-N
SMILES: CC(=CC=CC(=CC=CC(=CC=CC=C(C)C=CC=C(C)C=CC=C(C)C=CCC(C)(C)OC)C)C)C=CCC(C)(C)OC
Drug action: n/a
ClassyFire chemical classification:
- Kingdom: Organic compounds
- Superclass: Lipids and lipid-like molecules
- Class: Prenol lipids
- Subclass: Tetraterpenoids
- Class: Prenol lipids
- Superclass: Lipids and lipid-like molecules
| PDB/AF Accession | PyMOL script | Experimental / Predicted | Interacting ECOD domains | ECOD X-group name | LigPlot |
|---|---|---|---|---|---|
| 5B5M | Download | Experimental | e5b5mA1 e5b5m71 e5b5m91 e5b5m01 e5b5mA1 e5b5mD1 e5b5mF1 e5b5mE1 e5b5mD1 e5b5mF1 e5b5mI1 e5b5mG1 e5b5mF1 e5b5mI1 e5b5mK1 e5b5mJ1 e5b5mI1 e5b5mK1 e5b5mO1 e5b5mN1 e5b5mK1 e5b5mO1 e5b5mQ1 e5b5mP1 e5b5mO1 e5b5mQ1 e5b5mS1 e5b5mR1 e5b5mQ1 e5b5mS1 e5b5mU1 e5b5mT1 e5b5mM1 e5b5mS1 e5b5mU1 e5b5mW1 e5b5mV1 e5b5mU1 e5b5mW1 e5b5mY1 e5b5mX1 e5b5mW1 e5b5mY1 e5b5m11 e5b5mZ1 e5b5mY1 e5b5m11 e5b5m31 e5b5m21 e5b5m11 e5b5m31 e5b5m51 e5b5m41 e5b5m31 e5b5m51 e5b5m71 e5b5m61 e5b5m51 e5b5m71 e5b5m91 e5b5m81 e5b5mA1 e5b5mD1 e5b5m91 e5b5mB1 e5b5mm1 e5b5mp1 e5b5ml1 e5b5mn1 e5b5mm1 e5b5mp1 e5b5mr1 e5b5mq1 e5b5mp1 e5b5mr1 e5b5mu1 e5b5ms1 e5b5mr1 e5b5mu1 e5b5mw1 e5b5mv1 e5b5mu1 e5b5mw1 e5b5mAA1 e5b5mz1 e5b5mw1 e5b5mAA1 e5b5mAC1 e5b5mAB1 e5b5mAA1 e5b5mAC1 e5b5mAE1 e5b5mAD1 e5b5mAC1 e5b5mAE1 e5b5mAG1 e5b5mAF1 e5b5my1 e5b5mAE1 e5b5mAG1 e5b5mAI1 e5b5mAH1 e5b5mAG1 e5b5mAI1 e5b5mAK1 e5b5mAJ1 e5b5mAI1 e5b5mAK1 e5b5md1 e5b5mAL1 e5b5mAK1 e5b5md1 e5b5mf1 e5b5me1 e5b5md1 e5b5mf1 e5b5mh1 e5b5mg1 e5b5mf1 e5b5mh1 e5b5mj1 e5b5mi1 e5b5mh1 e5b5mj1 e5b5ml1 e5b5mk1 e5b5mm1 e5b5mj1 e5b5ml1 e5b5mc1 | Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial photosystem II reaction centre L and M subunits-like Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial photosystem II reaction centre L and M subunits-like Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits | LigPlot |
| 7C52 | Download | Experimental | e7c52A1 e7c52D1 e7c52F1 e7c52E1 e7c52A1 e7c52D1 e7c5291 e7c52B1 e7c52D1 e7c52F1 e7c52I1 e7c52G1 e7c52F1 e7c52I1 e7c52K1 e7c52J1 e7c52I1 e7c52K1 e7c52O1 e7c52N1 e7c52O1 e7c52Q1 e7c52S1 e7c52R1 e7c52K1 e7c52O1 e7c52Q1 e7c52P1 e7c52U1 e7c52T1 e7c52Q1 e7c52S1 e7c52M1 e7c52U1 e7c52S1 e7c52W1 e7c52V1 e7c52U1 e7c52W1 e7c52Y1 e7c52X1 e7c52W1 e7c52Y1 e7c5211 e7c52Z1 e7c52Y1 e7c5211 e7c5231 e7c5221 e7c5231 e7c5251 e7c5271 e7c5261 e7c5211 e7c5231 e7c5251 e7c5241 e7c5251 e7c5271 e7c5291 e7c5281 e7c52A1 e7c5271 e7c5291 e7c5281 e7c5201 | Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial photosystem II reaction centre L and M subunits-like Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits | LigPlot |
| 5Y5S | Download | Experimental | e5y5sA1 e5y5sD1 e5y5sF1 e5y5sE1 e5y5sD1 e5y5sF1 e5y5sI1 e5y5sG1 e5y5sF1 e5y5sI1 e5y5sK1 e5y5sJ1 e5y5sI1 e5y5sK1 e5y5sO1 e5y5sN1 e5y5sO1 e5y5sQ1 e5y5sS1 e5y5sR1 e5y5sK1 e5y5sO1 e5y5sQ1 e5y5sP1 e5y5sU1 e5y5sT1 e5y5sQ1 e5y5sS1 e5y5sU1 e5y5sW1 e5y5sY1 e5y5sX1 e5y5sM1 e5y5sU1 e5y5sS1 e5y5sW1 e5y5sV1 e5y5sW1 e5y5sY1 e5y5s11 e5y5sZ1 e5y5s11 e5y5s31 e5y5s51 e5y5s41 e5y5sY1 e5y5s11 e5y5s31 e5y5s21 e5y5s31 e5y5s51 e5y5s71 e5y5s41 e5y5s61 e5y5s51 e5y5s71 e5y5s91 e5y5s81 e5y5sA1 e5y5s71 e5y5s91 e5y5s01 | Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial photosystem II reaction centre L and M subunits-like Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits | LigPlot |
| 4V8K | Download | Experimental | e4v8kAA1 e4v8kAD1 e4v8kAF1 e4v8kAB1 e4v8kAE1 e4v8kAA1 e4v8kAD1 e4v8kA91 e4v8kAB1 e4v8kA01 e4v8kAD1 e4v8kAF1 e4v8kAI1 e4v8kAE1 e4v8kAG1 e4v8kAJ1 e4v8kAF1 e4v8kAI1 e4v8kAK1 e4v8kAG1 e4v8kAJ1 e4v8kAI1 e4v8kAK1 e4v8kAO1 e4v8kAN1 e4v8kAK1 e4v8kAO1 e4v8kAQ1 e4v8kAP1 e4v8kAO1 e4v8kAQ1 e4v8kAS1 e4v8kAR1 e4v8kAM1 e4v8kAS1 e4v8kAU1 e4v8kAW1 e4v8kAT1 e4v8kAV1 e4v8kAQ1 e4v8kAS1 e4v8kAU1 e4v8kAT1 e4v8kAW1 e4v8kAY1 e4v8kA11 e4v8kAZ1 e4v8kAU1 e4v8kAW1 e4v8kAY1 e4v8kAV1 e4v8kAX1 e4v8kA11 e4v8kA31 e4v8kA51 e4v8kA41 e4v8kAY1 e4v8kA11 e4v8kA31 e4v8kA21 e4v8kA41 e4v8kA51 e4v8kA71 e4v8kA91 e4v8kA81 e4v8kA31 e4v8kA51 e4v8kA71 e4v8kA61 e4v8kAA1 e4v8kA71 e4v8kA91 e4v8kA81 e4v8kA01 e4v8kBA1 e4v8kBD1 e4v8kBF1 e4v8kBB1 e4v8kBE1 e4v8kBA1 e4v8kBD1 e4v8kB91 e4v8kBB1 e4v8kBF1 e4v8kBI1 e4v8kBK1 e4v8kBG1 e4v8kBJ1 e4v8kBD1 e4v8kBF1 e4v8kBI1 e4v8kBE1 e4v8kBG1 e4v8kBJ1 e4v8kBI1 e4v8kBK1 e4v8kBO1 e4v8kBN1 e4v8kBO1 e4v8kBQ1 e4v8kBS1 e4v8kBR1 e4v8kBK1 e4v8kBO1 e4v8kBQ1 e4v8kBP1 e4v8kBR1 e4v8kBQ1 e4v8kBS1 e4v8kBU1 e4v8kBT1 e4v8kBL1 e4v8kBU1 e4v8kBW1 e4v8kBY1 e4v8kBV1 e4v8kBX1 e4v8kBZ1 e4v8kBM1 e4v8kBS1 e4v8kBU1 e4v8kBW1 e4v8kBV1 e4v8kBW1 e4v8kBY1 e4v8kB11 e4v8kBX1 e4v8kBZ1 e4v8kB11 e4v8kB31 e4v8kB51 e4v8kB41 e4v8kBY1 e4v8kB11 e4v8kB31 e4v8kBZ1 e4v8kB21 e4v8kB41 e4v8kB51 e4v8kB71 e4v8kB91 e4v8kB81 e4v8kB31 e4v8kB51 e4v8kB71 e4v8kB41 e4v8kB61 e4v8kB81 e4v8kBA1 e4v8kB71 e4v8kB91 e4v8kB01 | Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial photosystem II reaction centre L and M subunits-like Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial photosystem II reaction centre L and M subunits-like Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial photosystem II reaction centre L and M subunits-like Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits | LigPlot |
| 3WMM | Download | Experimental | e3wmmA1 e3wmmB1 e3wmmE1 e3wmmD1 e3wmmF1 e3wmmA1 e3wmmB1 e3wmmD1 e3wmm91 e3wmm01 e3wmmE1 e3wmmG1 e3wmmD1 e3wmmF1 e3wmmI1 e3wmmG1 e3wmmJ1 e3wmmF1 e3wmmI1 e3wmmK1 e3wmmJ1 e3wmmN1 e3wmmI1 e3wmmK1 e3wmmO1 e3wmmP1 e3wmmK1 e3wmmO1 e3wmmQ1 e3wmmR1 e3wmmO1 e3wmmQ1 e3wmmS1 e3wmmT1 e3wmmQ1 e3wmmS1 e3wmmU1 e3wmmM1 e3wmmT1 e3wmmV1 e3wmmS1 e3wmmU1 e3wmmW1 e3wmmZ1 e3wmmW1 e3wmmY1 e3wmm11 e3wmmL1 e3wmmV1 e3wmmX1 e3wmmU1 e3wmmW1 e3wmmY1 e3wmmZ1 e3wmm21 e3wmmY1 e3wmm11 e3wmm31 e3wmm41 e3wmm61 e3wmm31 e3wmm51 e3wmm71 e3wmm41 e3wmm11 e3wmm31 e3wmm51 e3wmm61 e3wmm81 e3wmm51 e3wmm71 e3wmm91 | Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial photosystem II reaction centre L and M subunits-like Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial photosystem II reaction centre L and M subunits-like Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits | LigPlot |
| 5B5N | Download | Experimental | e5b5nA1 e5b5nD1 e5b5nF1 e5b5nE1 e5b5nD1 e5b5nF1 e5b5nI1 e5b5nG1 e5b5nF1 e5b5nI1 e5b5nK1 e5b5nJ1 e5b5nI1 e5b5nK1 e5b5nO1 e5b5nN1 e5b5nK1 e5b5nO1 e5b5nQ1 e5b5nP1 e5b5nO1 e5b5nQ1 e5b5nS1 e5b5nR1 e5b5nQ1 e5b5nS1 e5b5nU1 e5b5nT1 e5b5nM1 e5b5nS1 e5b5nU1 e5b5nW1 e5b5nV1 e5b5nU1 e5b5nW1 e5b5nY1 e5b5nX1 e5b5nW1 e5b5nY1 e5b5n11 e5b5nZ1 e5b5nY1 e5b5n11 e5b5n31 e5b5n21 e5b5n11 e5b5n31 e5b5n51 e5b5n41 e5b5n51 e5b5n71 e5b5n91 e5b5n81 e5b5nA1 e5b5nD1 e5b5n91 e5b5nB1 e5b5nA1 e5b5n71 e5b5n91 e5b5n01 e5b5nm1 e5b5nj1 e5b5nl1 e5b5nc1 e5b5nm1 e5b5np1 e5b5nl1 e5b5nn1 e5b5nm1 e5b5np1 e5b5nr1 e5b5nq1 e5b5np1 e5b5nr1 e5b5nu1 e5b5ns1 e5b5nr1 e5b5nu1 e5b5nw1 e5b5nv1 e5b5nu1 e5b5nw1 e5b5nAA1 e5b5nz1 e5b5nw1 e5b5nAA1 e5b5nAC1 e5b5nAB1 e5b5nAA1 e5b5nAC1 e5b5nAE1 e5b5nAD1 e5b5nAC1 e5b5nAE1 e5b5nAG1 e5b5nAF1 e5b5ny1 e5b5nAE1 e5b5nAG1 e5b5nAI1 e5b5nAH1 e5b5nAG1 e5b5nAI1 e5b5nAK1 e5b5nAJ1 e5b5nAI1 e5b5nAK1 e5b5nd1 e5b5nAL1 e5b5nAK1 e5b5nd1 e5b5nf1 e5b5ne1 e5b5nd1 e5b5nf1 e5b5nh1 e5b5ng1 e5b5nf1 e5b5nh1 e5b5nj1 e5b5ni1 e5b5nh1 e5b5nj1 e5b5nl1 e5b5nk1 | Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial photosystem II reaction centre L and M subunits-like Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial photosystem II reaction centre L and M subunits-like Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits | LigPlot |