PDB ligand accession: UQ8
DrugBank: n/a
PubChem:
ChEMBL: n/a
InChI Key: ICFIZJQGJAJRSU-SGHXUWJISA-N
SMILES: CC1=C(C(=O)C(=C(C1=O)OC)OC)CC=C(C)CCC=C(C)CCC=C(C)CCC=C(C)CCC=C(C)CCC=C(C)CCC=C(C)CCC=C(C)C
Drug action: n/a
ClassyFire chemical classification:
- Kingdom: Organic compounds
- Superclass: Lipids and lipid-like molecules
- Class: Prenol lipids
- Subclass: Quinone and hydroquinone lipids
- Class: Prenol lipids
- Superclass: Lipids and lipid-like molecules
PDB/AF Accession | PyMOL script | Experimental / Predicted | Interacting ECOD domains | ECOD X-group name | LigPlot |
---|---|---|---|---|---|
7C52 | Download | Experimental | e7c52M1 e7c52Q1 e7c52S1 | Bacterial photosystem II reaction centre L and M subunits-like Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits | LigPlot |
5Y5S | Download | Experimental | e5y5sM1 e5y5sS1 e5y5sL1 e5y5s51 e5y5s71 e5y5s91 | Bacterial photosystem II reaction centre L and M subunits-like Bacterial light-harvesting complex subunits Bacterial photosystem II reaction centre L and M subunits-like Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits | LigPlot |