Ligand name: (6~{E},8~{E},10~{E},12~{E},14~{E},16~{E},18~{E},20~{E},22~{E},24~{E},26~{E})-2,31-dimethoxy-2,6,10,14,19,23,27,31-octamethyl-dotriaconta-6,8,10,12,14,16,18,20,22,24,26-undecaene
PDB ligand accession: H4X
DrugBank: n/a
PubChem: 5366411
ChEMBL: n/a
InChI Key: LCTIOHZQWXQPIB-VYCPWLLESA-N
SMILES: CC(=CC=CC(=CC=CC(=CC=CC=C(C)C=CC=C(C)C=CC=C(C)CCCC(C)(C)OC)C)C)CCCC(C)(C)OC
Drug action: n/a

ClassyFire chemical classification: No PTM data available

List of PDB structures and/or AlphaFold models with target protein H8Z3S4

PDB/AF Accession PyMOL script Experimental / Predicted Interacting ECOD domains ECOD X-group name LigPlot
7C9R Download Experimental e7c9rO1
e7c9rR1
e7c9rS1
e7c9rQ1
e7c9rK1
e7c9rO1
e7c9rP1
e7c9rQ1
e7c9rR1
e7c9rT1
e7c9rS1
e7c9rU1
e7c9rQ1
Bacterial light-harvesting complex subunits
Bacterial light-harvesting complex subunits
Bacterial light-harvesting complex subunits
Bacterial light-harvesting complex subunits
Bacterial light-harvesting complex subunits
Bacterial light-harvesting complex subunits
Bacterial light-harvesting complex subunits
Bacterial light-harvesting complex subunits
Bacterial light-harvesting complex subunits
Bacterial light-harvesting complex subunits
Bacterial light-harvesting complex subunits
Bacterial light-harvesting complex subunits
Bacterial light-harvesting complex subunits
LigPlot