PDB ligand accession: PL9
DrugBank: n/a
PubChem:
ChEMBL: n/a
InChI Key: FKUYMLZIRPABFK-UHFFFAOYSA-N
SMILES: CC1=C(C(=O)C(=CC1=O)CC=C(C)CCC=C(C)CCC=C(C)CCC=C(C)CCC=C(C)CCC=C(C)CCC=C(C)CCC=C(C)CCC=C(C)C)C
Drug action: n/a
ClassyFire chemical classification:
- Kingdom: Organic compounds
- Superclass: Lipids and lipid-like molecules
- Class: Prenol lipids
- Subclass: Quinone and hydroquinone lipids
- Class: Prenol lipids
- Superclass: Lipids and lipid-like molecules
| PDB/AF Accession | PyMOL script | Experimental / Predicted | Interacting ECOD domains | ECOD X-group name | LigPlot |
|---|---|---|---|---|---|
| 4YUU | Download | Experimental | e4yuuA11 e4yuuD11 e4yuuL11 e4yuuT11 e4yuua11 e4yuud11 e4yuul11 e4yuut11 e4yuuA21 e4yuuD21 e4yuuL21 e4yuuT21 e4yuua21 e4yuud21 e4yuul21 e4yuut21 | Bacterial photosystem II reaction centre L and M subunits-like Bacterial photosystem II reaction centre L and M subunits-like Photosystem II reaction center protein L, PsbL Photosystem II reaction center protein T, PsbT Bacterial photosystem II reaction centre L and M subunits-like Bacterial photosystem II reaction centre L and M subunits-like Photosystem II reaction center protein L, PsbL Photosystem II reaction center protein T, PsbT Bacterial photosystem II reaction centre L and M subunits-like Bacterial photosystem II reaction centre L and M subunits-like Photosystem II reaction center protein L, PsbL Photosystem II reaction center protein T, PsbT Bacterial photosystem II reaction centre L and M subunits-like Bacterial photosystem II reaction centre L and M subunits-like Photosystem II reaction center protein L, PsbL Photosystem II reaction center protein T, PsbT | LigPlot |