PDB ligand accession: BCL
DrugBank: DB01853
PubChem: 11953947;16057436;
ChEMBL: n/a
InChI Key: DSJXIQQMORJERS-AGGZHOMASA-M
SMILES: CCC1C(C2=CC3=C(C(=C4[N-]3[Mg+2]56[N]2=C1C=C7[N-]5C8=C(C(C(=O)C8=C7C)C(=O)OC)C9=[N]6C(=C4)C(C9CCC(=O)OCC=C(C)CCCC(C)CCCC(C)CCCC(C)C)C)C)C(=O)C)C
Drug action: n/a
ClassyFire chemical classification:
- Kingdom: Organic compounds
- Superclass: Organoheterocyclic compounds
- Class: Tetrapyrroles and derivatives
- Subclass: Metallotetrapyrroles
- Class: Tetrapyrroles and derivatives
- Superclass: Organoheterocyclic compounds
| PDB/AF Accession | PyMOL script | Experimental / Predicted | Interacting ECOD domains | ECOD X-group name | LigPlot |
|---|---|---|---|---|---|
| 6Z5R | Download | Experimental | e6z5rC1 e6z5rE1 e6z5rD1 e6z5rF1 e6z5rL1 e6z5rL1 e6z5rM1 | Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial photosystem II reaction centre L and M subunits-like Bacterial photosystem II reaction centre L and M subunits-like Bacterial photosystem II reaction centre L and M subunits-like | LigPlot |
| 6Z5S | Download | Experimental | e6z5sM1 e6z5sL1 e6z5sL1 e6z5sA1 e6z5sC1 e6z5sB1 e6z5sD1 | Bacterial photosystem II reaction centre L and M subunits-like Bacterial photosystem II reaction centre L and M subunits-like Bacterial photosystem II reaction centre L and M subunits-like Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits Bacterial light-harvesting complex subunits | LigPlot |