PDB ligand accession: n/a
DrugBank: DB01244
InChI Key:
SMILES: CC(C)COCC(CN(CC1=CC=CC=C1)C1=CC=CC=C1)N1CCCC1
Drug action: inhibitor
| PDB/AF Accession | PyMOL script | Experimental / Predicted | Interacting ECOD domains | ECOD X-group name |
|---|---|---|---|---|
| O95180 | Download | Predicted | O95180_F1_nD1 | Voltage-gated ion channels |