PDB ligand accession: HEM
DrugBank: DB18267
PubChem: n/a
ChEMBL: n/a
InChI Key: KABFMIBPWCXCRK-RGGAHWMASA-L
SMILES: Cc1c2n3c(c1CCC(=O)O)C=C4C(=C(C5=[N]4[Fe]36[N]7=C(C=C8N6C(=C5)C(=C8C)C=C)C(=C(C7=C2)C)C=C)C)CCC(=O)O
Drug action: n/a
| PDB/AF Accession | PyMOL script | Experimental / Predicted | Interacting ECOD domains | ECOD X-group name | LigPlot |
|---|---|---|---|---|---|
| 1NU1 | Download | Experimental | e1nu1C1 e1nu1C2 | a domain/subunit of cytochrome bc1 complex (Ubiquinol-cytochrome c reductase) Transmembrane heme-binding four-helical bundle | LigPlot |
| 1NTM | Download | Experimental | e1ntmC1 e1ntmC2 | a domain/subunit of cytochrome bc1 complex (Ubiquinol-cytochrome c reductase) Transmembrane heme-binding four-helical bundle | LigPlot |
| 4D6U | Download | Experimental | e4d6uC1 e4d6uC2 e4d6uP2 | a domain/subunit of cytochrome bc1 complex (Ubiquinol-cytochrome c reductase) Transmembrane heme-binding four-helical bundle Transmembrane heme-binding four-helical bundle | LigPlot |
| 1NTK | Download | Experimental | e1ntkC1 e1ntkC2 | a domain/subunit of cytochrome bc1 complex (Ubiquinol-cytochrome c reductase) Transmembrane heme-binding four-helical bundle | LigPlot |
| 1PPJ | Download | Experimental | e1ppjC1 e1ppjC2 e1ppjP1 e1ppjP2 | a domain/subunit of cytochrome bc1 complex (Ubiquinol-cytochrome c reductase) Transmembrane heme-binding four-helical bundle a domain/subunit of cytochrome bc1 complex (Ubiquinol-cytochrome c reductase) Transmembrane heme-binding four-helical bundle | LigPlot |
| 1QCR | Download | Experimental | e1qcrC2 | Transmembrane heme-binding four-helical bundle | LigPlot |
| 7R3V | Download | Experimental | e7r3vC1 e7r3vC2 | a domain/subunit of cytochrome bc1 complex (Ubiquinol-cytochrome c reductase) Transmembrane heme-binding four-helical bundle | LigPlot |
| 6ZFU | Download | Experimental | e6zfuC1 e6zfuC2 | a domain/subunit of cytochrome bc1 complex (Ubiquinol-cytochrome c reductase) Transmembrane heme-binding four-helical bundle | LigPlot |
| 5LUF | Download | Experimental | e5lufb1 e5lufb2 e5lufo1 e5lufo2 | Transmembrane heme-binding four-helical bundle a domain/subunit of cytochrome bc1 complex (Ubiquinol-cytochrome c reductase) a domain/subunit of cytochrome bc1 complex (Ubiquinol-cytochrome c reductase) Transmembrane heme-binding four-helical bundle | LigPlot |
| 1BGY | Download | Experimental | e1bgyC1 e1bgyC2 e1bgyO1 e1bgyO2 | a domain/subunit of cytochrome bc1 complex (Ubiquinol-cytochrome c reductase) Transmembrane heme-binding four-helical bundle a domain/subunit of cytochrome bc1 complex (Ubiquinol-cytochrome c reductase) Transmembrane heme-binding four-helical bundle | LigPlot |
| 7TZ6 | Download | Experimental | e7tz6C1 e7tz6C2 e7tz6P1 e7tz6P2 | Transmembrane heme-binding four-helical bundle a domain/subunit of cytochrome bc1 complex (Ubiquinol-cytochrome c reductase) Transmembrane heme-binding four-helical bundle a domain/subunit of cytochrome bc1 complex (Ubiquinol-cytochrome c reductase) | LigPlot |
| 2YBB | Download | Experimental | e2ybbC1 e2ybbC2 e2ybbc1 e2ybbc2 | Transmembrane heme-binding four-helical bundle a domain/subunit of cytochrome bc1 complex (Ubiquinol-cytochrome c reductase) a domain/subunit of cytochrome bc1 complex (Ubiquinol-cytochrome c reductase) Transmembrane heme-binding four-helical bundle | LigPlot |
| 5GPN | Download | Experimental | e5gpnC2 e5gpnO2 | Transmembrane heme-binding four-helical bundle Transmembrane heme-binding four-helical bundle | LigPlot |
| 6FO6 | Download | Experimental | e6fo6C1 e6fo6C2 e6fo6P1 e6fo6P2 | a domain/subunit of cytochrome bc1 complex (Ubiquinol-cytochrome c reductase) Transmembrane heme-binding four-helical bundle Transmembrane heme-binding four-helical bundle a domain/subunit of cytochrome bc1 complex (Ubiquinol-cytochrome c reductase) | LigPlot |
| 1BE3 | Download | Experimental | e1be3C1 e1be3C2 | a domain/subunit of cytochrome bc1 complex (Ubiquinol-cytochrome c reductase) Transmembrane heme-binding four-helical bundle | LigPlot |
| 4D6T | Download | Experimental | e4d6tC1 e4d6tC2 e4d6tP2 | a domain/subunit of cytochrome bc1 complex (Ubiquinol-cytochrome c reductase) Transmembrane heme-binding four-helical bundle Transmembrane heme-binding four-helical bundle | LigPlot |
| 1NTZ | Download | Experimental | e1ntzC1 e1ntzC2 | a domain/subunit of cytochrome bc1 complex (Ubiquinol-cytochrome c reductase) Transmembrane heme-binding four-helical bundle | LigPlot |
| 5NMI | Download | Experimental | e5nmiC1 e5nmiC2 e5nmiP1 e5nmiP2 | a domain/subunit of cytochrome bc1 complex (Ubiquinol-cytochrome c reductase) Transmembrane heme-binding four-helical bundle a domain/subunit of cytochrome bc1 complex (Ubiquinol-cytochrome c reductase) Transmembrane heme-binding four-helical bundle | LigPlot |
| 1L0N | Download | Experimental | e1l0nC1 e1l0nC2 | a domain/subunit of cytochrome bc1 complex (Ubiquinol-cytochrome c reductase) Transmembrane heme-binding four-helical bundle | LigPlot |
| 6ZFT | Download | Experimental | e6zftC1 e6zftC2 | Transmembrane heme-binding four-helical bundle a domain/subunit of cytochrome bc1 complex (Ubiquinol-cytochrome c reductase) | LigPlot |
| 6NHG | Download | Experimental | e6nhgC1 e6nhgC2 | a domain/subunit of cytochrome bc1 complex (Ubiquinol-cytochrome c reductase) Transmembrane heme-binding four-helical bundle | LigPlot |
| 7DKF | Download | Experimental | e7dkfC11 e7dkfC12 e7dkfO11 e7dkfO12 | Transmembrane heme-binding four-helical bundle a domain/subunit of cytochrome bc1 complex (Ubiquinol-cytochrome c reductase) Transmembrane heme-binding four-helical bundle a domain/subunit of cytochrome bc1 complex (Ubiquinol-cytochrome c reductase) | LigPlot |
| 6XVF | Download | Experimental | e6xvfC1 e6xvfC2 | a domain/subunit of cytochrome bc1 complex (Ubiquinol-cytochrome c reductase) Transmembrane heme-binding four-helical bundle | LigPlot |
| 6FO2 | Download | Experimental | e6fo2P1 e6fo2P2 e6fo2C1 e6fo2C2 | a domain/subunit of cytochrome bc1 complex (Ubiquinol-cytochrome c reductase) Transmembrane heme-binding four-helical bundle Transmembrane heme-binding four-helical bundle a domain/subunit of cytochrome bc1 complex (Ubiquinol-cytochrome c reductase) | LigPlot |
| 1L0L | Download | Experimental | e1l0lC1 e1l0lC2 | a domain/subunit of cytochrome bc1 complex (Ubiquinol-cytochrome c reductase) Transmembrane heme-binding four-helical bundle | LigPlot |
| 6ZFS | Download | Experimental | e6zfsC1 e6zfsC2 | a domain/subunit of cytochrome bc1 complex (Ubiquinol-cytochrome c reductase) Transmembrane heme-binding four-helical bundle | LigPlot |
| 7DGS | Download | Experimental | e7dgsm2 e7dgsy1 | Transmembrane heme-binding four-helical bundle Transmembrane heme-binding four-helical bundle | LigPlot |
| 5KLV | Download | Experimental | e5klvC1 e5klvC2 | a domain/subunit of cytochrome bc1 complex (Ubiquinol-cytochrome c reductase) Transmembrane heme-binding four-helical bundle | LigPlot |
| 7DGR | Download | Experimental | e7dgrm2 e7dgry2 | Transmembrane heme-binding four-helical bundle Transmembrane heme-binding four-helical bundle | LigPlot |
| 5OKD | Download | Experimental | e5okdC1 e5okdC2 | Transmembrane heme-binding four-helical bundle a domain/subunit of cytochrome bc1 complex (Ubiquinol-cytochrome c reductase) | LigPlot |
| 1PP9 | Download | Experimental | e1pp9C1 e1pp9C2 e1pp9P1 e1pp9P2 | a domain/subunit of cytochrome bc1 complex (Ubiquinol-cytochrome c reductase) Transmembrane heme-binding four-helical bundle a domain/subunit of cytochrome bc1 complex (Ubiquinol-cytochrome c reductase) Transmembrane heme-binding four-helical bundle | LigPlot |
| 6FO0 | Download | Experimental | e6fo0P1 e6fo0P2 e6fo0C1 e6fo0C2 | Transmembrane heme-binding four-helical bundle a domain/subunit of cytochrome bc1 complex (Ubiquinol-cytochrome c reductase) a domain/subunit of cytochrome bc1 complex (Ubiquinol-cytochrome c reductase) Transmembrane heme-binding four-helical bundle | LigPlot |
| 1SQB | Download | Experimental | e1sqbC1 e1sqbC2 | a domain/subunit of cytochrome bc1 complex (Ubiquinol-cytochrome c reductase) Transmembrane heme-binding four-helical bundle | LigPlot |
| 7TAY | Download | Experimental | e7tayC1 e7tayC2 | a domain/subunit of cytochrome bc1 complex (Ubiquinol-cytochrome c reductase) Transmembrane heme-binding four-helical bundle | LigPlot |
| 2A06 | Download | Experimental | e2a06C1 e2a06C2 e2a06P1 e2a06P2 | a domain/subunit of cytochrome bc1 complex (Ubiquinol-cytochrome c reductase) Transmembrane heme-binding four-helical bundle a domain/subunit of cytochrome bc1 complex (Ubiquinol-cytochrome c reductase) Transmembrane heme-binding four-helical bundle | LigPlot |
| 6HAW | Download | Experimental | e6hawC1 e6hawC2 | a domain/subunit of cytochrome bc1 complex (Ubiquinol-cytochrome c reductase) Transmembrane heme-binding four-helical bundle | LigPlot |
| 7DGQ | Download | Experimental | e7dgqm2 e7dgqy2 | Transmembrane heme-binding four-helical bundle Transmembrane heme-binding four-helical bundle | LigPlot |
| 2FYU | Download | Experimental | e2fyuC1 e2fyuC2 | a domain/subunit of cytochrome bc1 complex (Ubiquinol-cytochrome c reductase) Transmembrane heme-binding four-helical bundle | LigPlot |